Index of /web/uploads/files
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | (Unit 1&2) TOS-II.pdf | 2023-11-07 23:13 | 12M | |
| (Unit 1) TOS-II.pdf | 2023-11-07 23:13 | 12M | |
| (Unit 3,4&5) TOS-II.pdf | 2023-11-07 23:13 | 17M | |
![[IMG]](/icons/image2.gif) | 003111 2018-2019 Sch..> | 2023-11-07 23:13 | 117K | |
| 004635 AIDS Autonomo..> | 2023-11-07 23:13 | 565K | |
| 005838 4.2.3.pdf | 2023-11-07 23:13 | 537K | |
| 01 BE (CSE)2020-24 A..> | 2023-11-07 23:13 | 727K | |
![[ ]](/icons/unknown.gif) | 01Intro.ppt | 2023-11-07 23:13 | 320K | |
| 01_Induction program..> | 2023-11-07 23:13 | 743K | |
| 01_Induction program..> | 2023-11-07 23:13 | 787K | |
| 01_Induction program..> | 2023-11-07 23:13 | 708K | |
| 02Data.ppt | 2023-11-07 23:13 | 4.8M | |
| 02_async.pdf | 2023-11-07 23:13 | 535K | |
| 028878 water conserv..> | 2023-11-07 23:13 | 420K | |
| 029301 2015-16 EEE N..> | 2023-11-07 23:13 | 2.0M | |
| 029621 CBCS III & IV..> | 2023-11-07 23:13 | 794K | |
| 03Preprocessing.ppt | 2023-11-07 23:13 | 784K | |
| 032681 16-17Non CBCS..> | 2023-11-07 23:13 | 622K | |
| 033162 Student UserI..> | 2023-11-07 23:13 | 132K | |
| 04OLAP.ppt | 2023-11-07 23:13 | 663K | |
| 040472 2017-2018 Sch..> | 2023-11-07 23:13 | 88K | |
| 046753 17-18 CBCS II..> | 2023-11-07 23:13 | 809K | |
| 050552 18-19 AICTE I..> | 2023-11-07 23:13 | 734K | |
| 052521 IIYr-II SEM _..> | 2023-11-07 23:13 | 122K | |
| 053116 VI SEM 2018-1..> | 2023-11-07 23:13 | 75K | |
| 053714 Faculty UserI..> | 2023-11-07 23:13 | 20K | |
| 056678 I Sem 2016-17..> | 2023-11-07 23:13 | 456K | |
| 06FPBasic.ppt | 2023-11-07 23:13 | 1.5M | |
| 066120 V & VI sem.pdf | 2023-11-07 23:13 | 1.6M | |
| 07FPAdvanced.ppt | 2023-11-07 23:13 | 2.9M | |
| 070136 4.2.4.xlsx | 2023-11-07 23:13 | 7.9K | |
| 072720 4.1.3.xlsx | 2023-11-07 23:13 | 8.2K | |
| 079074 solor_compres..> | 2023-11-07 23:13 | 2.6M | |
| 08ClassBasic.ppt | 2023-11-07 23:13 | 3.0M | |
| 086372 6.1.2 uploads..> | 2023-11-07 23:13 | 146K | |
| 09ClassAdvanced.ppt | 2023-11-07 23:13 | 2.2M | |
| 092120 2017-18 ECE N..> | 2023-11-07 23:13 | 699K | |
| 093774 workshop semi..> | 2023-11-07 23:13 | 1.7M | |
| 098237 2017-18 ECE ..> | 2023-11-07 23:13 | 966K | |
| 1-ES_june2016 001.jpg | 2023-11-07 23:13 | 564K | |
| 1-Model Curriculum I..> | 2023-11-07 23:13 | 715K | |
| 1.12.2016 & 02.12.20..> | 2023-11-07 23:13 | 280K | |
| 1. BE AMC Civil 34 S..> | 2023-11-07 23:13 | 548K | |
| 1. CBCS 78 Civil Sch..> | 2023-11-07 23:13 | 672K | |
| 1. IV Year_BE_ECE_20..> | 2023-11-07 23:13 | 81K | |
| 1 st assignment.doc | 2023-11-07 23:13 | 55K | |
| 1st unit.pdf | 2023-11-07 23:13 | 2.8M | |
| 2-CBCS V & VI Sem.pdf | 2023-11-07 23:13 | 787K | |
| 2-ES_July2015 001.jpg | 2023-11-07 23:13 | 869K | |
| 2 nd assignment.doc | 2023-11-07 23:13 | 51K | |
| 2nd unit.pdf | 2023-11-07 23:14 | 4.5M | |
| 2nd unit C.pdf | 2023-11-07 23:14 | 506K | |
| 3-ES_jan2014 001.jpg | 2023-11-07 23:14 | 770K | |
| 3.UNIT-1.pdf | 2023-11-07 23:14 | 1.0M | |
![[VID]](/icons/movie.gif) | 3 Types of Rocks and..> | 2023-11-07 23:14 | 29M | |
| 3rd Unit.pdf | 2023-11-07 23:14 | 97K | |
| 4-ES_Dec2013 001.jpg | 2023-11-07 23:14 | 850K | |
| 4.UNIT-2.pdf | 2023-11-07 23:14 | 1.9M | |
| 4th &5th short QS.docx | 2023-11-07 23:14 | 181K | |
| 4th unit c notes (2)..> | 2023-11-07 23:14 | 291K | |
| 5.2 Stem Cells and C..> | 2023-11-07 23:14 | 28K | |
| 5.O.U_Previous_yrs_Q..> | 2023-11-07 23:14 | 10M | |
| 5.UNIT-3.pdf | 2023-11-07 23:14 | 919K | |
| 5th Unit 1G_to_5G_Dr..> | 2023-11-07 23:14 | 755K | |
| 6.UNIT-4.pdf | 2023-11-07 23:14 | 1.0M | |
| 7.UNIT-5.pdf | 2023-11-07 23:14 | 1.1M | |
| 8 Previous Q.P.pdf | 2023-11-07 23:14 | 464K | |
| 9.class timetables_p..> | 2023-11-07 23:15 | 229K | |
| 9.class timetables_p..> | 2023-11-07 23:15 | 172K | |
| 9.class timetables_p..> | 2023-11-07 23:15 | 215K | |
| 9.class timetables_p..> | 2023-11-07 23:15 | 254K | |
| 9.class timetables_p..> | 2023-11-07 23:15 | 232K | |
| 9.class timetables_p..> | 2023-11-07 23:15 | 225K | |
| 10ClusBasic.ppt | 2023-11-07 23:13 | 2.1M | |
| 11.Chemistry-LECTURE..> | 2023-11-07 23:13 | 501K | |
![[TXT]](/icons/text.gif) | 11.html | 2023-11-07 23:13 | 8.3K | |
| 11ClusAdvanced.ppt | 2023-11-07 23:13 | 3.6M | |
| 12Outlier.ppt | 2023-11-07 23:13 | 1.0M | |
| 13Trend.ppt | 2023-11-07 23:13 | 3.5M | |
| 15.EM1 PPT 1.pdf | 2023-11-07 23:13 | 112K | |
| 16-17CBCS i and II s..> | 2023-11-07 23:13 | 852K | |
| 16-17CBCS i and II s..> | 2023-11-07 23:13 | 907K | |
| 16-17Non CBCS III YE..> | 2023-11-07 23:13 | 664K | |
| 16-17Non CBCS III YE..> | 2023-11-07 23:13 | 622K | |
| 16.EM2 PPT.pdf | 2023-11-07 23:13 | 201K | |
| 17-18 CBCS III and I..> | 2023-11-07 23:13 | 809K | |
| 17-18 CBCS III and I..> | 2023-11-07 23:13 | 826K | |
| 17-18 Non CBCS IV -i..> | 2023-11-07 23:13 | 676K | |
| 17-18 Non CBCS IV -i..> | 2023-11-07 23:13 | 621K | |
| 17.EM3 PPT.pdf | 2023-11-07 23:13 | 130K | |
| 18-19 AICTE I and II..> | 2023-11-07 23:13 | 713K | |
| 18-19 AICTE I and II..> | 2023-11-07 23:13 | 734K | |
| 18-19 CBCS V and VI ..> | 2023-11-07 23:13 | 705K | |
| 18-19 CBCS V and VI ..> | 2023-11-07 23:13 | 738K | |
| 18.EM4 PPT.pdf | 2023-11-07 23:13 | 182K | |
| 19-20 co's (1) (1).pdf | 2023-11-07 23:13 | 1.1M | |
| 19-20 co's (1).pdf | 2023-11-07 23:13 | 1.1M | |
| 19.LASER PPT.pdf | 2023-11-07 23:13 | 1.8M | |
| 22-23 ODD-SEM MECH.pdf | 2023-11-07 23:14 | 3.8M | |
| 111.pdf | 2023-11-07 23:13 | 4.1M | |
| 800-2007.pdf | 2023-11-07 23:15 | 10M | |
| 2016-2017 Scheme Sem..> | 2023-11-07 23:14 | 106K | |
| 2016-2017 Scheme Sem..> | 2023-11-07 23:14 | 98K | |
| 2017-2018 Schem Sem ..> | 2023-11-07 23:14 | 88K | |
| 2017-2018 Scheme Sem..> | 2023-11-07 23:14 | 114K | |
| 2018-19 AY _Year wis..> | 2023-11-07 23:14 | 687K | |
| 2018-2019 Scheme Sem..> | 2023-11-07 23:14 | 117K | |
| 2018-2019 Scheme Sem..> | 2023-11-07 23:14 | 130K | |
| 2018-2019 VI Sem Ele..> | 2023-11-07 23:14 | 93K | |
| 2019-09-19 04_17_20p..> | 2023-11-07 23:14 | 676K | |
| 2019-09-19 04_17_32p..> | 2023-11-07 23:14 | 621K | |
| 2019-09-19 04_19_26p..> | 2023-11-07 23:14 | 676K | |
| 2019-09-19 04_19_36p..> | 2023-11-07 23:14 | 621K | |
| 2019-09-19 04_22_37p..> | 2023-11-07 23:14 | 130K | |
| 2019-09-19 04_23_46p..> | 2023-11-07 23:14 | 130K | |
| 2019-09-19 04_25_02p..> | 2023-11-07 23:14 | 883K | |
| 2019-09-19 04_25_24p..> | 2023-11-07 23:14 | 589K | |
| 2019-09-19 04_26_55p..> | 2023-11-07 23:14 | 637K | |
| 2019-09-19 04_27_56p..> | 2023-11-07 23:14 | 16K | |
| 2019-09-19 04_28_20p..> | 2023-11-07 23:14 | 14K | |
| 2019-09-19 04_28_38p..> | 2023-11-07 23:14 | 89K | |
| 2019-09-19 04_29_35p..> | 2023-11-07 23:14 | 604K | |
| 2019-09-19 04_31_27p..> | 2023-11-07 23:14 | 893K | |
| 2019-09-19 04_34_18p..> | 2023-11-07 23:14 | 548K | |
| 2019-10-15 09_58_53a..> | 2023-11-07 23:14 | 25K | |
| 2019-10-15 09_59_05a..> | 2023-11-07 23:14 | 31K | |
| 2019-10-15 09_59_53a..> | 2023-11-07 23:14 | 57K | |
| 2019-10-15 10_00_17a..> | 2023-11-07 23:14 | 21K | |
| 2019-10-15 10_01_03a..> | 2023-11-07 23:14 | 97K | |
| 2019-11-14 03_29_13p..> | 2023-11-07 23:14 | 370K | |
| 2019-11-14 04_21_35p..> | 2023-11-07 23:14 | 0 | |
| 2019-11-14 06_41_37a..> | 2023-11-07 23:14 | 174K | |
| 2019-11-28 10_30_09a..> | 2023-11-07 23:14 | 237K | |
| 2019-20-ALL Yrs COs ..> | 2023-11-07 23:14 | 791K | |
| 2019-20 COs CIVIL.pdf | 2023-11-07 23:14 | 199K | |
| 2019-20 Innovation i..> | 2023-11-07 23:14 | 2.0M | |
| 2020-21 COs Civil.pdf | 2023-11-07 23:14 | 126K | |
| 2020-21 Innovation i..> | 2023-11-07 23:14 | 3.2M | |
| 2020-21_III Sem_TT.pdf | 2023-11-07 23:14 | 81K | |
| 2020-21_VII Sem_TT.docx | 2023-11-07 23:14 | 30K | |
| 2020-21_V Sem_TT.docx | 2023-11-07 23:14 | 27K | |
| 2021-22 ALL Yrs COs ..> | 2023-11-07 23:14 | 2.9M | |
| 2022-23 ALL Yrs COs ..> | 2023-11-07 23:14 | 462K | |
| 2023-24 EVEN SEM.pdf | 2024-02-26 16:03 | 104K | |
| 2023-24 ODD SEM.PDF | 2024-02-26 16:02 | 696K | |
| 2903 ED QUESTION PA..> | 2023-11-07 23:14 | 288K | |
| 6049.-BUILDING-STONE..> | 2023-11-07 23:14 | 668K | |
| 8051.PDF | 2023-11-07 23:14 | 524K | |
| 8085-overview.pptx | 2023-11-07 23:14 | 590K | |
| 8086-ppt.pptx | 2023-11-07 23:14 | 2.2M | |
| 8086-unit-1.pptx | 2023-11-07 23:14 | 12M | |
| 8086 notes1.docx | 2023-11-07 23:14 | 297K | |
| 106015 16-17CBCS i a..> | 2023-11-07 23:13 | 852K | |
| 107707 18-19 AICTE I..> | 2023-11-07 23:13 | 713K | |
| 117886 7.1.14.pdf | 2023-11-07 23:13 | 1.2M | |
| 125070 4th Yr BE CSE..> | 2023-11-07 23:13 | 14M | |
| 140999 Minutes_17_Ma..> | 2023-11-07 23:13 | 61K | |
| 147037 1st and 2nd Y..> | 2023-11-07 23:13 | 4.5M | |
| 154826 16-17Non CBCS..> | 2023-11-07 23:13 | 664K | |
| 157343 CBCS I & II S..> | 2023-11-07 23:13 | 589K | |
| 172259 4.4.1.pdf | 2023-11-07 23:13 | 2.7M | |
| 172420 4th Yr BE CSE..> | 2023-11-07 23:14 | 14M | |
| 180245 6.2.3-2.pdf | 2023-11-07 23:13 | 66K | |
| 187794 Collection of..> | 2023-11-07 23:13 | 273K | |
| 189268 2014-15.pdf | 2023-11-07 23:13 | 648K | |
| 194529 1-Model Curri..> | 2023-11-07 23:13 | 715K | |
| 246734 MBA III AND I..> | 2023-11-07 23:14 | 1.3M | |
| 248416 BE CSE AI&DS ..> | 2023-11-07 23:14 | 1.4M | |
| 267132 Batch 2020 AY..> | 2023-11-07 23:14 | 1.2M | |
| 391787 III Sem.pdf | 2023-11-07 23:14 | 306K | |
| 485898 sample.pdf | 2023-11-07 23:14 | 3.0K | |
| 522792 IV Sem.pdf | 2023-11-07 23:14 | 272K | |
| 542205 4th Yr BE CSE..> | 2023-11-07 23:14 | 14M | |
| 555008 1st and 2nd Y..> | 2023-11-07 23:14 | 4.5M | |
| 556690 VII & VIII se..> | 2023-11-07 23:14 | 1.1M | |
| 586515 VII & VIII se..> | 2023-11-07 23:14 | 504K | |
| 595937 V and VI sem ..> | 2023-11-07 23:14 | 1.7M | |
| 608316 CSE Autonomou..> | 2023-11-07 23:14 | 661K | |
| 632209 III and IV se..> | 2023-11-07 23:14 | 807K | |
| 645680 ECE OU VII an..> | 2023-11-07 23:14 | 718K | |
| 647441 MBA I AND II ..> | 2023-11-07 23:14 | 1.3M | |
| 656148 AI&DS-SCHEME-..> | 2023-11-07 23:14 | 901K | |
| 677929 1st and 2nd Y..> | 2023-11-07 23:14 | 4.5M | |
| 754892 3rd Yr syllab..> | 2023-11-07 23:14 | 935K | |
| 765494 CSE Autonomou..> | 2023-11-07 23:14 | 661K | |
| 872312 ECE AY-2022-2..> | 2023-11-07 23:14 | 1.5M | |
| 895232 sample.pdf | 2023-11-07 23:15 | 3.0K | |
| 908857 CSE-SCHEME-SY..> | 2023-11-07 23:15 | 1.0M | |
| 259743280-solar-stri..> | 2023-11-07 23:14 | 1.8M | |
| ACADEMIC CLAENDARS F..> | 2023-11-07 23:15 | 5.1M | |
| ACS-ASSIGNMENT 1.pdf | 2023-11-07 23:15 | 484K | |
| ACS-SHORT Q & A.doc | 2023-11-07 23:15 | 234K | |
| ACS-STUDENT SEMINARS..> | 2023-11-07 23:15 | 14K | |
| ACS Lab Manual 2020-..> | 2023-11-07 23:15 | 2.0M | |
| AC SYLLABUS COPY.doc | 2023-11-07 23:15 | 36K | |
| ACS_ASSIGNMENT 2.pdf | 2023-11-07 23:15 | 268K | |
| ACS_NOTES (1).pdf | 2023-11-07 23:15 | 16M | |
| AC UNIT1.pdf | 2023-11-07 23:15 | 430K | |
| AC UNIT2.pdf | 2023-11-07 23:15 | 211K | |
| AC UNIT 3.pdf | 2023-11-07 23:15 | 453K | |
| AC UNIT4.pdf | 2023-11-07 23:15 | 165K | |
| AC UNIT 5.pdf | 2023-11-07 23:15 | 161K | |
| AC previous Question..> | 2023-11-07 23:15 | 125K | |
| AC previous question..> | 2023-11-07 23:15 | 140K | |
| AC previous question..> | 2023-11-07 23:15 | 119K | |
| AEC ASSIGNMENTS.docx | 2023-11-07 23:15 | 15K | |
| AEC Assignment 1.docx | 2023-11-07 23:15 | 87K | |
| AEC NOTES.pdf | 2023-11-07 23:15 | 17M | |
| AEC QUESTION BANK.docx | 2023-11-07 23:15 | 18K | |
| AEC QUIZ.docx | 2023-11-07 23:15 | 23K | |
| AEC notes.docx | 2023-11-07 23:15 | 5.6M | |
| AICTE 7 and 8 sem-20..> | 2024-02-26 15:59 | 1.6M | |
| AICTE NEW SCHEME- CU..> | 2023-11-07 23:15 | 4.0M | |
| AICTE OLD SCHEME-CUR..> | 2023-11-07 23:15 | 4.0M | |
| AIDS AND CSE SYLLA..> | 2023-11-07 23:15 | 432K | |
| AI_DS IV A AND B SE..> | 2024-04-03 06:06 | 102K | |
| AI_DS SEM-II A B C ..> | 2024-04-03 06:39 | 136K | |
| AI_DS Sem-III 2023-2..> | 2023-11-24 09:26 | 154K | |
| AI_DS Sem-IV 2023-24..> | 2023-11-24 09:26 | 151K | |
| AI_DS Sem-V 2023-24.pdf | 2023-11-24 09:25 | 199K | |
| AI_DS Sem-VI 2023-24..> | 2023-11-24 09:25 | 200K | |
| AI_DS Syllabus for ..> | 2023-11-07 23:15 | 1.7M | |
| AI_DS VI A AND B SE..> | 2024-04-03 06:06 | 166K | |
| AI_DS VIII SEM TIME..> | 2024-04-03 06:07 | 152K | |
| AI_ML SEM-II A B C ..> | 2024-04-03 06:38 | 195K | |
| ALUMNI FEEDBACK FORM..> | 2023-11-07 23:15 | 31K | |
| AMC I _ II SEM Sylla..> | 2023-11-07 23:15 | 494K | |
| AMC V _ VI SEM Sylla..> | 2023-11-07 23:15 | 430K | |
| AMTA Notes.docx | 2023-11-07 23:15 | 2.5M | |
| ANALOG COMMUNICATION..> | 2023-11-07 23:15 | 8.2M | |
| ARI-C-26074.pdf | 2023-11-07 23:15 | 65K | |
| A Rajasekhar MMFM Un..> | 2023-11-07 23:15 | 9.6M | |
| ASIC1.pdf | 2023-11-07 23:15 | 506K | |
| ASM1.pdf | 2023-11-07 23:15 | 381K | |
| ASM notes.docx | 2023-11-07 23:15 | 491K | |
| ASSEMBLY LANGUAGE PR..> | 2023-11-07 23:15 | 135K | |
| ASSGN 1.docx | 2023-11-07 23:15 | 17K | |
| ASSIGNMENT QUESTIONS..> | 2023-11-07 23:15 | 12K | |
| ASSIGNMENT QUESTIONS..> | 2023-11-07 23:15 | 12K | |
| ASSIGNMENT QUESTIONS..> | 2023-11-07 23:15 | 13K | |
| ATD AIR COMPRESSORS ..> | 2023-11-07 23:16 | 9.3M | |
| ATD BOILERS UNIT-4 P..> | 2023-11-07 23:16 | 4.7M | |
| ATD CI ENGINE COMBUS..> | 2023-11-07 23:16 | 6.1M | |
| ATD IC ENGINES CUT S..> | 2023-11-07 23:16 | 3.5M | |
| ATD IC ENGINES UNIT-..> | 2023-11-07 23:16 | 5.7M | |
| ATD IC ENGINES UNIT-..> | 2023-11-07 23:16 | 3.3M | |
| ATD NOZZLES UNIT- 5 ..> | 2023-11-07 23:16 | 670K | |
| ATD SI ENGINE COMBUS..> | 2023-11-07 23:16 | 4.9M | |
| ATD STEAM CONDENSERS..> | 2023-11-07 23:16 | 2.3M | |
| ATD STEAM CYCLES- NO..> | 2023-11-07 23:16 | 5.4M | |
| ATM-system.docx | 2023-11-07 23:16 | 114K | |
| AWP CBCS-ECE-V_VI_Se..> | 2023-11-07 23:16 | 916K | |
| AWP QUIZ QUESTIONS.pdf | 2023-11-07 23:16 | 8.0M | |
| AY_2019-20 WEB PROGR..> | 2023-11-07 23:16 | 2.8M | |
| Academic Calendar II..> | 2023-11-07 23:15 | 17K | |
| Active-and-passive-v..> | 2023-11-07 23:15 | 347K | |
| Activities organised..> | 2023-11-07 23:15 | 459K | |
| Almanac MBA Sem-I 20..> | 2023-11-07 23:15 | 343K | |
| Almanac MBA Sem-III ..> | 2023-11-07 23:15 | 287K | |
| Almanac MBA Sem-IV 2..> | 2023-11-07 23:15 | 286K | |
| Almanac for 2018-19.jpg | 2023-11-07 23:15 | 1.0M | |
| Applications of Biot..> | 2023-11-07 23:15 | 79K | |
| Applied Thermo Dynam..> | 2023-11-07 23:16 | 67M | |
| Arrays.pdf | 2023-11-07 23:15 | 430K | |
| Assignment 6TH SEM E..> | 2023-11-07 23:15 | 17K | |
| Assignmnet 1 UEE.docx | 2023-11-07 23:15 | 21K | |
| Astable Multivibrato..> | 2023-11-07 23:16 | 25M | |
| Automata-Theory-Note..> | 2023-11-07 23:16 | 746K | |
| Automous Certificate..> | 2023-11-07 23:16 | 79K | |
| B.E-III-Sem Almanac.pdf | 2024-02-26 15:53 | 7.6M | |
| B.E.II Sem (Autonomo..> | 2023-11-07 23:16 | 177K | |
| B.E. Minor in AI & M..> | 2023-11-07 23:16 | 442K | |
| B.E. Minor in Cyber ..> | 2023-11-07 23:16 | 417K | |
| B.E. Minor in Electr..> | 2023-11-07 23:16 | 547K | |
| B.E. Minor in IOT Sc..> | 2023-11-07 23:16 | 5.9M | |
| B.E. Minor in Real E..> | 2023-11-07 23:16 | 232K | |
| B.E. Minor in Roboti..> | 2023-11-07 23:16 | 447K | |
| B.E Honors - AI_DS S..> | 2023-11-07 23:16 | 431K | |
| B.E Honors - CIVIL S..> | 2023-11-07 23:16 | 197K | |
| B.E Honors - CSE Sch..> | 2023-11-07 23:16 | 873K | |
| B.E Honors - ECE Sch..> | 2023-11-07 23:16 | 1.4M | |
| B.E Honors - EEE Sch..> | 2023-11-07 23:16 | 430K | |
| B.E Honors - MECH Sc..> | 2023-11-07 23:16 | 424K | |
| B.E III Sem.jpg | 2023-11-17 12:42 | 210K | |
| B.E I Sem.jpg | 2023-11-17 12:42 | 215K | |
| B.E MECH-AUTONOMOUS ..> | 2023-11-07 23:16 | 1.1M | |
| B.E V Sem.jpg | 2023-11-17 12:43 | 221K | |
| BC_NOTES_UNIT I.docx | 2023-11-07 23:16 | 662K | |
| BC_NOTES_UNIT II.docx | 2023-11-07 23:16 | 24K | |
| BC_NOTES_UNIT III.docx | 2023-11-07 23:16 | 17K | |
| BE-12-RULES_AND_REGU..> | 2023-11-07 23:16 | 287K | |
| BE-12-RULES_AND_REGU..> | 2023-11-07 23:16 | 287K | |
| BE-12-sem-syllabus.pdf | 2023-11-07 23:16 | 968K | |
| BE-34-sem-syllabus.pdf | 2023-11-07 23:16 | 193K | |
| BE-78-sem-syllabus.pdf | 2023-11-07 23:16 | 5.8M | |
| BE31_201605_5141S.pdf | 2023-11-07 23:16 | 188K | |
| BE AICTE III SEM ED ..> | 2023-11-07 23:16 | 568K | |
| BLDC.ppt | 2023-11-07 23:17 | 880K | |
| BLOCK DIAGRAM REDUCT..> | 2023-11-07 23:17 | 1.2M | |
| BOD problem solving.mp4 | 2023-11-07 23:17 | 13M | |
| BOD theory.mp4 | 2023-11-07 23:17 | 15M | |
| BOG_MEMBERS.pdf | 2023-11-07 23:17 | 432K | |
| BOSmembers from EEE.pdf | 2023-11-07 23:17 | 1.1M | |
| Bioreactors Types.doc | 2023-11-07 23:16 | 175K | |
| Bistable Multivibrat..> | 2023-11-07 23:17 | 33M | |
| Braking system.pptx | 2023-11-07 23:17 | 5.2M | |
| C-files.pdf | 2023-11-07 23:17 | 158K | |
| CAE (aicte) Lab Manu..> | 2023-11-07 23:17 | 15M | |
| CA Lab CIVIL.pdf | 2023-11-07 23:17 | 1.8M | |
| CAPD & CAM Lab Manua..> | 2023-11-07 23:17 | 5.2M | |
| CARBURETION and fuel..> | 2023-11-07 23:17 | 4.7M | |
| CBCS-Civil-V_VI_Sem-..> | 2023-11-07 23:17 | 1.7M | |
| CBCS VII _ VIII SEM ..> | 2023-11-07 23:17 | 436K | |
| CC Lab Manual 2020-2..> | 2023-11-07 23:17 | 1.0M | |
| CC_unify.docx | 2023-11-07 23:17 | 15K | |
| CIVIL-2020-21.pdf | 2023-11-07 23:18 | 6.4M | |
| CIVIL COMBINED CURR..> | 2023-11-07 23:17 | 396K | |
| CIVIL Course Outcome..> | 2023-11-07 23:18 | 203K | |
| CIVIL Graphics Manua..> | 2023-11-07 23:18 | 7.6M | |
| CIVIL IVSEM-TT.pdf | 2024-04-03 06:27 | 254K | |
| CIVIL SYLLABUS-I.pdf | 2023-11-07 23:18 | 450K | |
| CIVIL VI-sem TT.pdf | 2024-04-03 06:28 | 247K | |
| CIVIL VIII-A-TT.pdf | 2024-04-03 22:48 | 500K | |
| C Lab Manual 2020-21..> | 2023-11-07 23:17 | 905K | |
| CO'S 20-21 (1).pdf | 2023-11-07 23:18 | 534K | |
| COA 2.docx | 2023-11-07 23:18 | 34K | |
| COA Assignment 1.pdf | 2023-11-07 23:18 | 146K | |
| COA notes.pdf | 2023-11-07 23:18 | 7.8M | |
| CO IMP QS FINAL.pdf | 2023-11-07 23:18 | 130K | |
| COMPUTER ORGANIZATIO..> | 2023-11-07 23:18 | 5.3M | |
| COURSE OUTCOMES SEM-..> | 2023-11-07 23:18 | 1.3M | |
| CO_RECORD_IVB_RSD.pdf | 2023-11-07 23:19 | 32M | |
| CO assignment-I.pdf | 2023-11-07 23:18 | 326K | |
| CPM & PERT.pdf | 2023-11-07 23:19 | 1.4M | |
| CSE-2020-21.pdf | 2023-11-07 23:19 | 8.1M | |
| CSE COs 2018 - 2019.pdf | 2023-11-07 23:19 | 1.1M | |
| CSE IV SEM TIME TABL..> | 2024-04-03 06:07 | 153K | |
| CSE Sem-III 2023-24.pdf | 2023-11-24 09:21 | 156K | |
| CSE Sem-IV 2023-24.pdf | 2023-11-24 09:21 | 151K | |
| CSE Sem-V 2023-24.pdf | 2023-11-24 07:43 | 201K | |
| CSE Sem-VI 2023-24.pdf | 2023-11-24 07:43 | 204K | |
| CSE VI A AND B SEM ..> | 2024-04-03 06:08 | 166K | |
| CSE VIII SEM TIME TA..> | 2024-04-03 06:08 | 163K | |
| CT LAB.pdf | 2023-11-07 23:19 | 14M | |
| CW 1)FUNCTIONS OF CO..> | 2023-11-07 23:19 | 13M | |
| CW Curve fitting uni..> | 2023-11-07 23:19 | 8.8M | |
| CW Numerical methods..> | 2023-11-07 23:19 | 17M | |
| Cell theory and 5 Ki..> | 2023-11-07 23:17 | 5.9M | |
| Characterstics of En..> | 2023-11-07 23:17 | 73K | |
| Chemical Fuels-Mod..pdf | 2023-11-07 23:17 | 546K | |
| Chpt-5-Counting_v.4.ppt | 2023-11-07 23:17 | 1.9M | |
| Class-1.pdf | 2023-11-07 23:18 | 1.0M | |
| Classification Of Pr..> | 2023-11-07 23:18 | 34K | |
| College ACADEMIC_CAL..> | 2023-11-07 23:18 | 412K | |
| College ACADEMIC_CAL..> | 2023-11-07 23:18 | 459K | |
| Communication Lab Ma..> | 2023-11-07 23:18 | 4.6M | |
| Compounding and Blen..> | 2023-11-07 23:18 | 16K | |
| Comprehension passag..> | 2023-11-07 23:18 | 59K | |
| Computer Organizatio..> | 2023-11-07 23:18 | 413K | |
| Coulomb's law.mp4 | 2023-11-07 23:18 | 111M | |
| DBMS_FAQs.docx | 2023-11-07 23:19 | 94K | |
| DC-UNIT 1 short Ques..> | 2023-11-07 23:19 | 31K | |
| DC-Unit2.pdf | 2023-11-07 23:19 | 1.7M | |
| DC-unit -5.pdf | 2023-11-07 23:19 | 1.8M | |
| DC-unit1.pdf | 2023-11-07 23:19 | 5.4M | |
| DC-unit1B.pdf | 2023-11-07 23:19 | 3.8M | |
| DC-unit3B.pdf | 2023-11-07 23:19 | 1.5M | |
| DC-unit8 -5.pdf | 2023-11-07 23:20 | 1.8M | |
| DCCN Lab manual -VI ..> | 2023-11-07 23:19 | 2.8M | |
| DCCN_LECTURE_NOTES_U..> | 2023-11-07 23:20 | 6.8M | |
| DC Machines.pdf | 2023-11-07 23:19 | 6.6M | |
| DC Unit 2 short Que..> | 2023-11-07 23:19 | 31K | |
| DC motors.pdf | 2023-11-07 23:19 | 3.3M | |
| DC unit 1notes.pdf | 2023-11-07 23:19 | 7.8M | |
| DC unit 2 material.pdf | 2023-11-07 23:19 | 8.0M | |
| DDVL ASSIGNMENT-2.docx | 2023-11-07 23:20 | 10K | |
| DDVL assignment-1.docx | 2023-11-07 23:20 | 11K | |
| DDVL notes2.pdf | 2023-11-07 23:20 | 6.3M | |
| DIGITAL COMMUNICATIO..> | 2023-11-07 23:20 | 9.9M | |
| DIS Lab Manual 2020-..> | 2023-11-07 23:20 | 2.1M | |
| DMA CONTROLLER.docx | 2023-11-07 23:20 | 261K | |
| DME -2011QP.PDF | 2023-11-07 23:20 | 151K | |
| DME-2012QP.PDF | 2023-11-07 23:20 | 143K | |
| DME-FLUCTUATING LOAD..> | 2023-11-07 23:20 | 4.4M | |
| DME 2013QP.pdf | 2023-11-07 23:20 | 277K | |
| DME 2014QP.pdf | 2023-11-07 23:20 | 92K | |
| DME ALL UNITS NOTES ..> | 2023-11-07 23:20 | 7.6M | |
| DM Lab Manual 2020-2..> | 2023-11-07 23:20 | 3.2M | |
| DMM-UNIT-I-PPT.pptx | 2023-11-07 23:20 | 4.0M | |
| DMM-UNIT -II.pptx | 2023-11-07 23:20 | 502K | |
| DMM_UNIT-V.pptx | 2023-11-07 23:20 | 115K | |
| DMS-CSE-2A-Assignmen..> | 2023-11-07 23:20 | 98K | |
| DOMESTIC SEWAGE.pdf.pdf | 2023-11-07 23:20 | 3.5M | |
| DOM Lab Manual.pdf | 2023-11-07 23:20 | 2.3M | |
| DOM SHORT ANSWERS.pdf | 2023-11-07 23:20 | 303K | |
| DOM UNIT -1 NOTES.pdf | 2023-11-07 23:20 | 11M | |
| DOM UNIT 1 NOTES CON..> | 2023-11-07 23:20 | 2.2M | |
| DOM UNIT 5 NOTES.pdf | 2023-11-07 23:20 | 101K | |
| DOM_Notes_Final.pdf | 2023-11-07 23:20 | 26M | |
| DOM unit 3 notes.pdf | 2023-11-07 23:20 | 7.8M | |
| DR jwc IOT.pdf | 2023-11-07 23:20 | 4.5M | |
| DSA Lab Manual 2020-..> | 2023-11-07 23:20 | 3.1M | |
| DSP-TUTORIALS QUESTI..> | 2023-11-07 23:21 | 21K | |
| DSP ASSIGNMENT 3.docx | 2023-11-07 23:20 | 16K | |
| DSP ASSIGNMENT 4.docx | 2023-11-07 23:20 | 15K | |
| DSP ASSIGNMENT_2.docx | 2023-11-07 23:20 | 14K | |
| DSPI_CDF (2018-19).docx | 2023-11-07 23:21 | 119K | |
| DSP Lecture notesn.pdf | 2023-11-07 23:20 | 20M | |
| DSP NOTES.pdf | 2023-11-07 23:21 | 5.1M | |
| DSP UNIT-V Notes.docx | 2023-11-07 23:21 | 1.6M | |
| DSP_ASSIGNMENT 1.docx | 2023-11-07 23:21 | 13K | |
| DSP_SYLLABUS.pdf | 2023-11-07 23:21 | 233K | |
| Dams-Reservoirs.pptx | 2023-11-07 23:19 | 1.0M | |
| Data-Structures-Note..> | 2023-11-07 23:19 | 81K | |
| Dc-unit3A.pdf | 2023-11-07 23:19 | 2.7M | |
| Development.ppt | 2023-11-07 23:20 | 2.1M | |
| Digital Communicatio..> | 2023-11-07 23:20 | 4.0M | |
| Direct indirect spee..> | 2023-11-07 23:20 | 17K | |
| Dom unit 2.pdf | 2023-11-07 23:20 | 5.8M | |
| Drilling Jig.mp4 | 2023-11-07 23:21 | 34M | |
| E-RESOURSES M_I.docx | 2023-11-07 23:21 | 11K | |
| E-Resources.docx | 2023-11-07 23:21 | 11K | |
| EBM LBM PPT 12.02.16..> | 2023-11-07 23:21 | 37M | |
| ECE-2020-21.pdf | 2023-11-07 23:21 | 8.5M | |
| ECE Autonomous Sylla..> | 2024-02-26 15:56 | 445K | |
| ECE IV A AND B SEMES..> | 2024-04-03 06:14 | 214K | |
| ECE SYLLABUS-I.pdf | 2023-11-07 23:21 | 496K | |
| ECE Sem-III 2023-24.pdf | 2023-11-24 09:33 | 173K | |
| ECE Sem-IV 2023-24.pdf | 2023-11-24 09:33 | 168K | |
| ECE Sem-V 2023-24.pdf | 2023-11-24 09:32 | 197K | |
| ECE Sem-VI 2023-24.pdf | 2023-11-24 09:32 | 226K | |
| ECE VIII A AND B SEM..> | 2024-04-03 06:14 | 198K | |
| ECE_EDC NOTES ALL UN..> | 2023-11-07 23:21 | 6.4M | |
| EDA Lab manual.pdf | 2023-11-07 23:21 | 3.7M | |
| EDC_Material.pdf | 2023-11-07 23:21 | 6.6M | |
| EDM ppt notes.docx | 2023-11-07 23:21 | 11M | |
| EDP_ Opportunities a..> | 2023-11-07 23:21 | 87K | |
| EDP_Types_of_Busines..> | 2023-11-07 23:21 | 1.2M | |
| EDP_intro.pptx | 2023-11-07 23:21 | 37K | |
| ED question Bank.docx | 2023-11-07 23:21 | 31K | |
| ED unit 1.pdf | 2023-11-07 23:21 | 7.5M | |
| ED unit 2.pdf | 2023-11-07 23:21 | 3.8M | |
| ED unit 3.pdf | 2023-11-07 23:21 | 7.3M | |
| ED unit 4.pdf | 2023-11-07 23:21 | 2.8M | |
| ED unit 5.pdf | 2023-11-07 23:21 | 1.2M | |
| EE 1_20191219135658.pdf | 2023-11-07 23:22 | 26M | |
| EEE-2020-21.pdf | 2023-11-07 23:21 | 4.0M | |
| EEE A.Y 2023-24, IV ..> | 2024-04-03 06:20 | 411K | |
| EEE AY 23-24 VI sem ..> | 2024-04-03 06:21 | 401K | |
| EEE COs for Even Se..> | 2023-11-07 23:21 | 420K | |
| EEE COs for Odd Sem..> | 2023-11-07 23:21 | 460K | |
| EEE COs for Odd Sem..> | 2023-11-07 23:21 | 613K | |
| EEE COs of Even sem ..> | 2023-11-07 23:21 | 289K | |
| EEE SYLLABUS-I.pdf | 2023-11-07 23:21 | 445K | |
| EEE Sem-III 2023-24.pdf | 2023-11-24 09:31 | 184K | |
| EEE Sem-IV 2023-24.pdf | 2023-11-24 09:31 | 185K | |
| EEE Sem-V 2023-24.pdf | 2023-11-24 09:31 | 212K | |
| EEE Sem-VI 2023-24.pdf | 2023-11-24 09:30 | 230K | |
| EEE VIII SEM TT.pdf | 2024-04-03 06:29 | 308K | |
| EEE_Laboratory.pdf | 2023-11-07 23:21 | 1.4M | |
| EEE cos of odd sem20..> | 2023-11-07 23:21 | 292K | |
| EI_3.06A_Types_of_Bu..> | 2023-11-07 23:21 | 1.7M | |
| EM & TL 2 MARKS Q&A.pdf | 2023-11-07 23:21 | 609K | |
| EMPLOYEE FEEDBACK FO..> | 2023-11-07 23:21 | 31K | |
| EMTL-sravan scanned ..> | 2023-11-07 23:22 | 60M | |
| EMTL ASSIGNMETN-I.docx | 2023-11-07 23:21 | 86K | |
| EMTL ASSIGNMETN-II.docx | 2023-11-07 23:21 | 86K | |
| ENGG GRAPHICS MANUAL..> | 2023-11-07 23:23 | 17M | |
| ENGINEERING MECHANIC..> | 2023-11-07 23:22 | 3.2M | |
| E RESOURCES.docx | 2023-11-07 23:21 | 13K | |
| ES-Assignment-1 2018..> | 2023-11-07 23:22 | 17K | |
| ES-Assignment-2 2018..> | 2023-11-07 23:22 | 18K | |
| ES-unit-1.pdf | 2023-11-07 23:22 | 13M | |
| ES502ECE_AWP-II_CDF ..> | 2023-11-07 23:22 | 124K | |
| ES Unit -1.pdf | 2023-11-07 23:22 | 8.6M | |
| ES Unit -2.pdf | 2023-11-07 23:22 | 5.1M | |
| ETC notes (1).pdf | 2023-11-07 23:23 | 5.1M | |
| EXTRA.pdf | 2023-11-07 23:23 | 221K | |
| Ecosystem.ppt | 2023-11-07 23:21 | 2.5M | |
| Electrochemistry & B..> | 2023-11-07 23:21 | 550K | |
| Embedded Systems-uni..> | 2023-11-07 23:21 | 13M | |
| Energy_Statistics_20..> | 2023-11-07 23:22 | 1.5M | |
| Eng Lang Lab Manual ..> | 2023-11-07 23:22 | 813K | |
| Engg Graphics CIVIL.pdf | 2023-11-07 23:22 | 25M | |
| Engineering Chemistr..> | 2023-11-07 23:22 | 48K | |
| English Assignment I..> | 2023-11-07 23:22 | 14K | |
| English Assignment I..> | 2023-11-07 23:22 | 10K | |
| English notes.docx | 2023-11-07 23:22 | 386K | |
| Environmental pollut..> | 2023-11-07 23:22 | 2.7M | |
| Estimation Costing S..> | 2023-11-07 23:23 | 5.6M | |
| Estimation Costing S..> | 2023-11-07 23:23 | 16M | |
| Estimation of Culver..> | 2023-11-07 23:23 | 1.2M | |
| Even Sem Time Table.pdf | 2023-11-07 23:23 | 2.2M | |
| Even Sem almanac 202..> | 2023-11-07 23:23 | 2.1M | |
| Evolution.ppt | 2023-11-07 23:23 | 1.4M | |
| Extendend-profile_20..> | 2023-11-07 23:23 | 77K | |
| FA-Unit2.pdf | 2023-11-07 23:23 | 2.9M | |
| FA Assignment 2.pdf | 2023-11-07 23:23 | 3.0M | |
| FACTS notes - V sem ..> | 2023-11-07 23:23 | 3.7M | |
| FACTS syllabus.docx | 2023-11-07 23:23 | 93K | |
| FA_Assignment.pdf | 2023-11-07 23:23 | 3.0M | |
| FA_Unit1.pdf | 2023-11-07 23:23 | 6.7M | |
| FDMppt.pptx | 2023-11-07 23:23 | 1.3M | |
| FDP attended - resou..> | 2023-11-07 23:23 | 229K | |
| FDP organised.pdf | 2023-11-07 23:23 | 109K | |
| FDP planned.pdf | 2023-11-07 23:23 | 106K | |
| FEA Notes_Final.pdf | 2023-11-07 23:23 | 47M | |
| FIRST().jpg | 2023-11-07 23:23 | 21K | |
| FM-2.pdf | 2023-11-07 23:24 | 9.1M | |
| FMHM Lab Manual.pdf | 2023-11-07 23:24 | 2.6M | |
| FOOTSTEP BEARING.mp4 | 2023-11-07 23:24 | 16M | |
| Fixed Bias Bistable ..> | 2023-11-07 23:24 | 65M | |
| Fluid Mechanics- Uni..> | 2023-11-07 23:24 | 4.2M | |
| Fluid Mechanics Unit..> | 2023-11-07 23:23 | 6.8M | |
| Fluid Mechanics Unit..> | 2023-11-07 23:23 | 3.8M | |
| Fluid Mechanics Unit..> | 2023-11-07 23:24 | 6.5M | |
| Fluid Mechanics Unit..> | 2023-11-07 23:24 | 4.4M | |
| Follow().jpg | 2023-11-07 23:24 | 21K | |
| Formats of Buisness ..> | 2023-11-07 23:24 | 1.1M | |
| Functions of Managem..> | 2023-11-07 23:24 | 214K | |
| GEOLOGY OF DAMS & R..> | 2023-11-07 23:24 | 1.2M | |
| GIT - ppt I &III.ppt | 2023-11-07 23:24 | 1.7M | |
| GIT-ppt II,IV &V.ppt | 2023-11-07 23:24 | 448K | |
| GRAMMER Assignments.pdf | 2023-11-07 23:24 | 2.3M | |
| GRIHA_V2015_May2016.pdf | 2023-11-07 23:24 | 4.3M | |
| Geometric Series Tes..> | 2023-11-07 23:24 | 152K | |
| Geomorphology.pptx | 2023-11-07 23:24 | 3.7M | |
| Grammar.jpg | 2023-11-07 23:24 | 46K | |
| Graphical Method , C..> | 2023-11-07 23:24 | 1.2M | |
| Graphics 5th Ed.pdf | 2023-11-07 23:26 | 256M | |
| Graphs-Def-BFS-DFS-S..> | 2023-11-07 23:24 | 2.1M | |
| Green Building notes..> | 2023-11-07 23:24 | 13M | |
| Green Chemistry and ..> | 2023-11-07 23:24 | 352K | |
| Groundwater.pptx | 2023-11-07 23:24 | 1.0M | |
| H & S 2018-19 sem I&..> | 2023-11-07 23:24 | 711K | |
| H & S 2020-21 SEM-I ..> | 2023-11-07 23:24 | 525K | |
| HCI Notes.pdf | 2023-11-07 23:24 | 5.9M | |
| HCI Unit 1.pdf | 2023-11-07 23:24 | 619K | |
| HCI Unit 2.pdf | 2023-11-07 23:24 | 1.1M | |
| HM(2).pdf | 2023-11-07 23:25 | 17M | |
| HMS Unit-2.pdf | 2023-11-07 23:25 | 4.4M | |
| HMS Unit-3.pdf | 2023-11-07 23:25 | 4.0M | |
| HMS Unit - 4.pdf | 2023-11-07 23:25 | 2.6M | |
| HMS Unit-5.pdf | 2023-11-07 23:25 | 2.4M | |
| HMS unit -1.pdf | 2023-11-07 23:25 | 7.3M | |
| HRM-OU.doc | 2023-11-07 23:25 | 404K | |
| HTML5NotesForProfess..> | 2023-11-07 23:25 | 1.3M | |
| HTML_Forms.jpg | 2023-11-07 23:25 | 49K | |
| HUM-2020-21.pdf | 2023-11-07 23:25 | 5.1M | |
| HUMAN DISEASES-notes..> | 2023-11-07 23:25 | 312K | |
| Homonyms, Homophones..> | 2023-11-07 23:25 | 32K | |
| Hypotheses about the..> | 2023-11-07 23:25 | 19K | |
| ICA Lab Manual.pdf | 2023-11-07 23:25 | 3.4M | |
| ICT TOOLS USAGE_Dr.J..> | 2023-11-07 23:25 | 1.4M | |
| IGBC Green Homes - A..> | 2023-11-07 23:25 | 492K | |
| II, IV & VI Sem Alma..> | 2024-03-15 11:45 | 932K | |
| II Assignment questi..> | 2023-11-07 23:25 | 12K | |
| III & IV SEM SYLLABU..> | 2023-11-07 23:25 | 1.8M | |
| IM_Syllabus.docx | 2023-11-07 23:25 | 16K | |
| IM_Unit-1.pptx | 2023-11-07 23:25 | 98K | |
| IM_Unit-2.docx | 2023-11-07 23:25 | 38K | |
| IM_Unit-3.pptx | 2023-11-07 23:25 | 51K | |
| IM_Unit-4.docx | 2023-11-07 23:25 | 36K | |
| INSPECTION OF CASTIN..> | 2023-11-07 23:26 | 465K | |
| INTERFACE.docx | 2023-11-07 23:26 | 54K | |
| IRC-6-2000.pdf | 2023-11-07 23:26 | 4.2M | |
| ITS.docx | 2023-11-07 23:26 | 393K | |
| IV-SEM 2020-21 TIME ..> | 2023-11-07 23:26 | 1.3M | |
| IV-SEM TIMETABLE MEC..> | 2024-04-03 05:29 | 832K | |
| IV mm (1).docx | 2023-11-07 23:26 | 20K | |
| If by Rudyard Kiplin..> | 2023-11-07 23:25 | 31K | |
| I have a Dream.docx | 2023-11-07 23:25 | 17K | |
| Immunology_Lecture6A..> | 2023-11-07 23:25 | 874K | |
| Induction Motors PPT..> | 2023-11-07 23:25 | 4.8M | |
![[DIR]](/icons/folder.gif) | Induction Program/ | 2023-11-08 07:46 | - | |
| Influenza.docx | 2023-11-07 23:25 | 513K | |
| Innovative teaching ..> | 2023-11-07 23:25 | 1.1M | |
| Innovative teaching ..> | 2023-11-07 23:25 | 22M | |
| Innovavative teachin..> | 2023-11-07 23:26 | 528K | |
| Insertion Sort-Stude..> | 2023-11-07 23:26 | 346K | |
| Institutional_Grade_..> | 2023-11-07 23:26 | 555K | |
| Intersection of soli..> | 2023-11-07 23:26 | 4.4M | |
| Intersectionsofsolid..> | 2023-11-07 23:26 | 398K | |
| Introduction To Auto..> | 2023-11-07 23:26 | 21M | |
| Intze Tank.ppt | 2023-11-07 23:26 | 230K | |
| Invitation for Orien..> | 2023-11-07 23:26 | 78K | |
| KOM-Unit-1-2 PPT.ppt | 2023-11-07 23:27 | 28M | |
| L-39(NKD)(PE) ((EE)N..> | 2023-11-07 23:27 | 241K | |
| L1.ppt | 2023-11-07 23:27 | 77K | |
| L2.ppt | 2023-11-07 23:27 | 85K | |
| L3.ppt | 2023-11-07 23:27 | 143K | |
| L4.ppt | 2023-11-07 23:27 | 195K | |
| L5.ppt | 2023-11-07 23:27 | 135K | |
| L6.ppt | 2023-11-07 23:27 | 106K | |
| L7.ppt | 2023-11-07 23:27 | 243K | |
| L8.ppt | 2023-11-07 23:27 | 2.3M | |
| L9.ppt | 2023-11-07 23:27 | 2.3M | |
| L10.ppt | 2023-11-07 23:27 | 2.7M | |
| L11.ppt | 2023-11-07 23:27 | 2.9M | |
| L12.ppt | 2023-11-07 23:27 | 2.4M | |
| L13.ppt | 2023-11-07 23:27 | 1.9M | |
| L14.ppt | 2023-11-07 23:27 | 90K | |
| L16.ppt | 2023-11-07 23:27 | 9.8M | |
| L17.ppt | 2023-11-07 23:27 | 257K | |
| L18.ppt | 2023-11-07 23:27 | 376K | |
| L19.ppt | 2023-11-07 23:27 | 313K | |
| L20.ppt | 2023-11-07 23:27 | 1.2M | |
| L20StateDiag03.pdf | 2023-11-07 23:27 | 3.3M | |
| L21_1.pdf | 2023-11-07 23:27 | 2.0M | |
| LECTURE NOTES.pptx | 2023-11-07 23:29 | 8.7M | |
| LEEDv4forBuildingDes..> | 2023-11-07 23:29 | 1.4M | |
| LIST OF EXP CO LAB.pdf | 2023-11-07 23:29 | 29K | |
| LOM.pptx | 2023-11-07 23:29 | 619K | |
| Lec-1 Introduction t..> | 2023-11-07 23:28 | 86M | |
| Lec-22 Basic Princip..> | 2023-11-07 23:28 | 128M | |
| Lec-35 The Nyquist S..> | 2023-11-07 23:29 | 137M | |
| LeeSeshia_DigitalV2_..> | 2023-11-07 23:29 | 26M | |
| Linkage SME.pptx | 2023-11-07 23:29 | 52K | |
| Links of teaching ma..> | 2023-11-07 23:29 | 17K | |
| M.E I Sem CAD CAM.jpg | 2023-11-17 12:43 | 145K | |
| MBA & ME almanac.jpg | 2023-11-07 23:30 | 182K | |
| MBA I & II Sem Syll..> | 2023-11-07 23:30 | 84K | |
| MBA I-III sem TT 202..> | 2023-11-07 23:30 | 1.1M | |
| MBA II-IV sem Time t..> | 2023-11-07 23:30 | 565K | |
| MBA III & IV SEM Syl..> | 2023-11-07 23:30 | 87K | |
| MBA II SEMESTER.pdf | 2024-04-03 22:52 | 262K | |
| MBA I Sem.jpg | 2023-11-17 12:43 | 172K | |
| MBA IV SEMESTER.pdf | 2024-04-03 22:59 | 263K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 300K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 191K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 292K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 289K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 289K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 192K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 286K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 290K | |
| MBA course outcomes ..> | 2023-11-07 23:30 | 289K | |
| MCET (A) MBA STRUCTU..> | 2023-11-07 23:30 | 949K | |
| MCMT - UNIT-1 - PPT..> | 2023-11-07 23:30 | 5.6M | |
| MDM Lab Manual.pdf | 2023-11-07 23:30 | 4.6M | |
| MDM Lab Manual OU Ma..> | 2023-11-07 23:30 | 5.9M | |
| ME,MBA OU.jpg | 2023-11-07 23:30 | 192K | |
| ME CADCAM course str..> | 2023-11-07 23:30 | 435K | |
| MECH-2020-21.pdf | 2023-11-07 23:30 | 11M | |
| MECH 2019-20 CO-PO f..> | 2023-11-07 23:30 | 4.2M | |
| MECH 2020-2021 CO-PO..> | 2023-11-07 23:30 | 1.7M | |
| MECHANICS.pdf | 2023-11-07 23:30 | 9.3M | |
| MECHANICS11.pdf | 2023-11-07 23:30 | 5.4M | |
| MECH SYLLABUS-I.pdf | 2023-11-07 23:30 | 407K | |
| MECH Sem-III 2023-24..> | 2023-11-24 09:35 | 201K | |
| MECH Sem-IV 2023-24.pdf | 2023-11-24 09:35 | 173K | |
| MECH Sem-V 2023-24.pdf | 2023-11-24 09:35 | 182K | |
| MECH Sem-VI 2023-24.pdf | 2023-11-24 09:34 | 211K | |
| MH notes.pdf | 2023-11-07 23:31 | 14M | |
| MMFM Unit 3 - EBM.pdf | 2023-11-07 23:31 | 153K | |
| MMFM Unit 3 - IBM.pdf | 2023-11-07 23:31 | 370K | |
| MMFM Unit 3 - LBM.pdf | 2023-11-07 23:31 | 203K | |
| MMFM Unit 3 - PAM.pdf | 2023-11-07 23:31 | 243K | |
| MMFM Unit 4 - Extra ..> | 2023-11-07 23:31 | 656K | |
| MMFM Unit 4 - HERF.pdf | 2023-11-07 23:31 | 665K | |
| MMFM Unit 4 - Rubber..> | 2023-11-07 23:31 | 239K | |
| MMFM Unit 5 - Stretc..> | 2023-11-07 23:31 | 201K | |
| MMFM Unit 5 - Tube S..> | 2023-11-07 23:31 | 430K | |
| MMFM Unit 5 - Water ..> | 2023-11-07 23:31 | 114K | |
| MMFM Unit II ECM.pptx | 2023-11-07 23:31 | 3.7M | |
| MMFM Unit II EDM dtd..> | 2023-11-07 23:31 | 8.2M | |
| MMS Unit-1.pdf | 2023-11-07 23:32 | 16M | |
| MMS Unit-2.pdf | 2023-11-07 23:31 | 2.9M | |
| MMS Unit-3.pdf | 2023-11-07 23:31 | 6.8M | |
| MMS Unit-4.pdf | 2023-11-07 23:31 | 4.4M | |
| MMS Unit-5.pdf | 2023-11-07 23:31 | 2.3M | |
| MMT Lab Manual.pdf | 2023-11-07 23:31 | 2.7M | |
| MOM IMP QUESTIONS.pdf | 2023-11-07 23:32 | 363K | |
| MOU_ECE.pdf | 2023-11-07 23:32 | 1.0M | |
| MP Lab Manual.pdf | 2023-11-07 23:32 | 1.7M | |
| MPMC-Assignment-1.pdf | 2023-11-07 23:32 | 21K | |
| MPMC-Assignment-2.pdf | 2023-11-07 23:32 | 12K | |
| MPMC-Assignment-3.pdf | 2023-11-07 23:32 | 48K | |
| MPMC Lab Manual.pdf | 2023-11-07 23:32 | 3.0M | |
| MPMC NOTES.pdf | 2023-11-07 23:32 | 7.4M | |
| MWE 2 marks Q&A -fo..> | 2023-11-07 23:32 | 1.0M | |
| MWE ASSIGNMETN-I.docx | 2023-11-07 23:32 | 86K | |
| MWE ASSIGNMETN-II.docx | 2023-11-07 23:32 | 86K | |
| MWE Lab Manual.pdf | 2023-11-07 23:32 | 5.0M | |
| M_I-1.ppt | 2023-11-07 23:33 | 5.4M | |
| M_I-II.ppt | 2023-11-07 23:33 | 8.2M | |
| M_I-PC604ME-ASSIGNME..> | 2023-11-07 23:33 | 18K | |
| M_ INSTR_N.ppt | 2023-11-07 23:32 | 5.2M | |
| M_I nots.pdf | 2023-11-07 23:32 | 4.3M | |
| Machine Assembly Mod..> | 2023-11-07 23:30 | 2.2M | |
| Mandatory disclosure..> | 2023-11-07 23:30 | 4.7M | |
| Market analysis.pptx | 2023-11-07 23:30 | 106K | |
| Mechanics of Materia..> | 2023-11-07 23:30 | 1.4M | |
| Memory-Organization.ppt | 2023-11-07 23:30 | 1.0M | |
| Mergesort-Students.pptx | 2023-11-07 23:30 | 91K | |
| Metal forming unit 5..> | 2023-11-07 23:31 | 15M | |
| Metal spinning.pptx | 2023-11-07 23:31 | 1.6M | |
| Metrology _ MT Lab M..> | 2023-11-07 23:31 | 3.0M | |
| Mod 1.pptx | 2023-11-07 23:31 | 14M | |
| Mod 5.pptx | 2023-11-07 23:31 | 1.7M | |
| Module 1.docx | 2023-11-07 23:31 | 1.5M | |
| Module 3.docx | 2023-11-07 23:32 | 8.7M | |
| Module 4.pptx | 2023-11-07 23:32 | 5.0M | |
| Module 5.docx | 2023-11-07 23:32 | 843K | |
| Monostable Multivibr..> | 2023-11-07 23:33 | 131M | |
| Murthy Notes.pdf | 2023-11-07 23:32 | 4.0M | |
| NAAC certificate (1)..> | 2023-11-07 23:33 | 236K | |
| NBA_Certificate_2021..> | 2023-11-07 23:33 | 462K | |
| NBA_Certificate_2024..> | 2024-04-25 15:15 | 367K | |
| NPTEL LINKS.docx | 2023-11-07 23:33 | 11K | |
| NT LAB.pdf | 2023-11-07 23:33 | 7.9M | |
| New Doc 2019-09-28 1..> | 2023-11-07 23:33 | 740K | |
| New Doc 2019-11-07 1..> | 2023-11-07 23:33 | 7.2M | |
| New Doc 2019-11-18 1..> | 2023-11-07 23:33 | 1.5M | |
| New Doc 2019-12-23 1..> | 2023-11-07 23:33 | 7.0M | |
| New Doc 2019-12-25 1..> | 2023-11-07 23:33 | 285K | |
| New Doc 2020-02-25 1..> | 2023-11-07 23:33 | 7.8M | |
| New Doc 2020-02-28 0..> | 2023-11-07 23:33 | 4.2M | |
| New Doc 2020-02-28 1..> | 2023-11-07 23:33 | 256K | |
| New Doc 2020-02-28 1..> | 2023-11-07 23:33 | 6.3M | |
| New Doc 2020-02-28 1..> | 2023-11-07 23:33 | 6.3M | |
| New Microsoft Office..> | 2023-11-07 23:33 | 27K | |
| Nitrogen Fixation.docx | 2023-11-07 23:33 | 648K | |
| Normalization.pdf | 2023-11-07 23:33 | 395K | |
| Note on Memo.pdf | 2023-11-07 23:33 | 759K | |
| O.U Engineering Chem..> | 2023-11-07 23:34 | 10M | |
| OFC_Tutorial Bank.doc | 2023-11-07 23:34 | 266K | |
| OS Lab Manual 2020-2..> | 2023-11-07 23:34 | 2.4M | |
| OS MannualFinal 2018..> | 2023-11-07 23:34 | 713K | |
| OU-BE-English-Texts.pdf | 2023-11-07 23:34 | 354K | |
| OU-Engg-English-Syll..> | 2023-11-07 23:34 | 355K | |
| OU-Engg-English-Syll..> | 2023-11-07 23:34 | 365K | |
| OU_PREVIOUS PAPERS.pdf | 2023-11-07 23:34 | 5.1M | |
| Object-Based Databas..> | 2023-11-07 23:34 | 4.9M | |
| Objectives of SSI.pptx | 2023-11-07 23:34 | 849K | |
| Odd sem Almanac 2022..> | 2023-11-07 23:34 | 319K | |
| Odd sem TimeTable.pdf | 2023-11-07 23:34 | 2.5M | |
| Operating_System_Con..> | 2023-11-07 23:34 | 5.2M | |
| Opportunities _ Chal..> | 2023-11-07 23:34 | 79K | |
| Optical Fiber Commun..> | 2023-11-07 23:34 | 7.8M | |
| Optical Fiber Commun..> | 2023-11-07 23:34 | 10M | |
| Ou almanac.jpg | 2023-11-07 23:34 | 262K | |
| PAM IBM.pptx | 2023-11-07 23:34 | 9.6M | |
| PARENT FEEDBACK FOR..> | 2023-11-07 23:34 | 131K | |
| PART-A.pdf | 2023-11-07 23:34 | 261K | |
| PART A SHEETS.pdf | 2023-11-07 23:34 | 4.0M | |
| PART B SHEETS.pdf | 2023-11-07 23:34 | 6.2M | |
| PATENTS ECE.pdf | 2023-11-07 23:34 | 259K | |
| PDIC SHORT Q&A.doc | 2023-11-07 23:34 | 84K | |
| PDIC Syllabus.docx | 2023-11-07 23:34 | 12K | |
| PDIC UNIT-1.pdf | 2023-11-07 23:34 | 7.9M | |
| PDIC UNIT-2.pdf | 2023-11-07 23:34 | 9.8M | |
| PDIC UNIT-3.pdf | 2023-11-07 23:34 | 15M | |
| PDIC UNIT-4.pdf | 2023-11-07 23:34 | 6.4M | |
| PDIC UNIT-5.pdf | 2023-11-07 23:34 | 1.4M | |
| PDIC assignment-1.docx | 2023-11-07 23:34 | 10K | |
| PDIC assignment2.docx | 2023-11-07 23:34 | 11K | |
| PDPP Unit - 1.pdf | 2023-11-07 23:34 | 195K | |
| PDPP Unit - 4.pdf | 2023-11-07 23:34 | 362K | |
| PDPP Unit - 5.pdf | 2023-11-07 23:34 | 928K | |
| PDPP Unit - II [Comp..> | 2023-11-07 23:34 | 329K | |
| PDPP unit - III.pdf | 2023-11-07 23:35 | 547K | |
| PE672EC _DCCN_VI_CDF..> | 2023-11-07 23:35 | 113K | |
| PGBP_Syllabus_CBCS_P..> | 2023-11-07 23:35 | 200K | |
| POM.pdf | 2023-11-07 23:35 | 7.0M | |
| POM 1 (1).pdf | 2023-11-07 23:35 | 3.9M | |
| POM2.pdf | 2023-11-07 23:35 | 472K | |
| PPT.pdf | 2023-11-07 23:35 | 6.9M | |
| PQ Unit-III.pdf | 2023-11-07 23:35 | 40M | |
| PQ Unit 4 and 5.pdf | 2023-11-07 23:35 | 5.5M | |
| PREVIOUS QUESTION PA..> | 2023-11-07 23:35 | 3.4M | |
| PRODUCTION DRAWING I..> | 2023-11-07 23:36 | 7.5M | |
| PRODUCTION DRAWING L..> | 2023-11-07 23:35 | 8.7M | |
| PRODUCTION DRAWING S..> | 2023-11-07 23:35 | 7.1M | |
| PTSP 2019 Class Note..> | 2023-11-07 23:36 | 7.8M | |
| PTSP Assignment 2019..> | 2023-11-07 23:36 | 113K | |
| PTSP Quiz 1 2019.docx | 2023-11-07 23:36 | 34K | |
| PTSP Quiz 2 2019.docx | 2023-11-07 23:36 | 35K | |
| Photosynthesis.docx | 2023-11-07 23:35 | 587K | |
| Piston & Connecting ..> | 2023-11-07 23:35 | 1.3M | |
| Placement_List_ECE.pdf | 2023-11-07 23:35 | 5.0M | |
| Placement_List_EEE.pdf | 2023-11-07 23:35 | 6.1M | |
| Placement_List_MECH.pdf | 2023-11-07 23:35 | 9.2M | |
| Plant layout Notes.pdf | 2023-11-07 23:35 | 139K | |
| Plummer Block Animat..> | 2023-11-07 23:35 | 645K | |
| Polymer Chemistry-Mo..> | 2023-11-07 23:35 | 551K | |
| Power quality.pptx | 2023-11-07 23:35 | 912K | |
| Presentation on Cybe..> | 2023-11-07 23:35 | 17M | |
| Product EDiMate app ..> | 2023-11-07 23:35 | 786K | |
| Product Interactive ..> | 2023-11-07 23:35 | 1.2M | |
| Programme Management..> | 2023-11-07 23:35 | 40K | |
| Programming in C-Pet..> | 2023-11-07 23:36 | 14M | |
| Projection-of-Point-..> | 2023-11-07 23:36 | 5.9M | |
| Projection-of-SoliD...> | 2023-11-07 23:36 | 654K | |
| Projection-of-planes..> | 2023-11-07 23:36 | 330K | |
| QUESTION BANK-SATT.pdf | 2023-11-07 23:36 | 5.3M | |
| QUESTION BANK.docx | 2023-11-07 23:36 | 17K | |
| QUIZ.docx | 2023-11-07 23:36 | 11K | |
| QUIZ 1_ACS 2018-19 I..> | 2023-11-07 23:36 | 13K | |
| QUIZ 2_ACS 2018-19 I..> | 2023-11-07 23:36 | 14K | |
| Question Paper 001.jpg | 2023-11-07 23:36 | 350K | |
| Question Paper 002.jpg | 2023-11-07 23:36 | 341K | |
| Question Paper 003.jpg | 2023-11-07 23:36 | 318K | |
| Question Paper 004.jpg | 2023-11-07 23:36 | 372K | |
| Question Paper 005.jpg | 2023-11-07 23:36 | 303K | |
| Question Paper 006.jpg | 2023-11-07 23:36 | 403K | |
| Question Paper 007.jpg | 2023-11-07 23:36 | 304K | |
| Question Paper 008.jpg | 2023-11-07 23:36 | 356K | |
| Question Paper 009.jpg | 2023-11-07 23:36 | 353K | |
| Question Paper 010.jpg | 2023-11-07 23:36 | 352K | |
| Question Paper 011.jpg | 2023-11-07 23:36 | 348K | |
| Question Paper 012.jpg | 2023-11-07 23:36 | 380K | |
| Question Paper 013.jpg | 2023-11-07 23:36 | 321K | |
| Question Paper 014.jpg | 2023-11-07 23:36 | 449K | |
| Question Paper 015.jpg | 2023-11-07 23:36 | 408K | |
| Queuing Theory OR Wa..> | 2023-11-07 23:36 | 5.9M | |
| Quiz paper I for Eng..> | 2023-11-07 23:36 | 13K | |
| R & AC UNIT-1 LECTUR..> | 2023-11-07 23:36 | 11M | |
| R & AC UNIT-2 LECTUR..> | 2023-11-07 23:36 | 8.4M | |
| R & AC UNIT-3 LECTUR..> | 2023-11-07 23:36 | 3.6M | |
| R & AC UNIT-4 LECTUR..> | 2023-11-07 23:36 | 4.3M | |
| R & AC UNIT-5 LECTUR..> | 2023-11-07 23:36 | 4.9M | |
| RES UNIT-4 Biomass.pptx | 2023-11-07 23:36 | 1.3M | |
| RK Narayan-A Horse a..> | 2023-11-07 23:36 | 5.5M | |
| RKNarayans Horse and..> | 2023-11-07 23:36 | 41K | |
| RM & IPR Notes Unit ..> | 2023-11-07 23:36 | 107K | |
| RM & IPR Notes Unit ..> | 2023-11-07 23:36 | 96K | |
| RM & IPR Notes Unit ..> | 2023-11-07 23:36 | 47K | |
| RM & IPR Notes Unit ..> | 2023-11-07 23:36 | 190K | |
| RM & IPR Notes Unit ..> | 2023-11-07 23:36 | 64K | |
| RM & IPR Notes Unit ..> | 2023-11-07 23:36 | 27K | |
| RNotesIV.docx | 2023-11-07 23:36 | 2.4M | |
| ROCK MECHANICS.pdf | 2023-11-07 23:36 | 508K | |
| R_D Professional Mem..> | 2023-11-07 23:36 | 349K | |
| R_D Research Publica..> | 2023-11-07 23:36 | 731K | |
| Remini20210413152340..> | 2023-11-07 23:36 | 134K | |
| Research Publication..> | 2023-11-07 23:36 | 239K | |
| Research Publication..> | 2023-11-07 23:36 | 397K | |
| Revised_M.E_Almanac_..> | 2023-11-07 23:36 | 64K | |
| Rmf in Induction mot..> | 2023-11-07 23:36 | 627K | |
| RootLocus.pptx | 2023-11-07 23:36 | 535K | |
| Rubber pad forming.pptx | 2023-11-07 23:37 | 5.1M | |
| S & S TWO MARKS Q&A.pdf | 2023-11-07 23:36 | 468K | |
| S&S UNIT-1.pdf | 2023-11-07 23:36 | 7.3M | |
| S&S UNIT-2.pdf | 2023-11-07 23:36 | 5.1M | |
| S&S UNIT-3.pdf | 2023-11-07 23:37 | 14M | |
| S&S UNIT-4.pdf | 2023-11-07 23:37 | 8.2M | |
| S&S UNIT-5.pdf | 2023-11-07 23:37 | 7.2M | |
| S&S papers.pdf | 2023-11-07 23:36 | 2.7M | |
| SATT 2 MARK Q&A.pdf | 2023-11-07 23:37 | 421K | |
| SATT ASSIGNMETN-I.docx | 2023-11-07 23:37 | 92K | |
| SATT ASSIGNMETN-II.docx | 2023-11-07 23:37 | 87K | |
| SATT UNIT-1.pdf | 2023-11-07 23:37 | 13M | |
| SATT UNIT-2.pdf | 2023-11-07 23:37 | 14M | |
| SATT UNIT-3.pdf | 2023-11-07 23:37 | 7.3M | |
| SATT UNIT-5.pdf | 2023-11-07 23:37 | 8.3M | |
| SEDDI UNIT1.pdf | 2023-11-07 23:37 | 23M | |
| SELab Manual 2020-21..> | 2023-11-07 23:37 | 6.9M | |
| SEM-II CIVIL TIME T..> | 2024-04-03 06:35 | 115K | |
| SEM-II CSE A B C SEC..> | 2024-04-03 06:39 | 136K | |
| SEM-II ECE TIME TAB..> | 2024-04-03 06:38 | 184K | |
| SEM-II EEE TIME TAB..> | 2024-04-03 06:35 | 173K | |
| SEM-II MECH TIME TA..> | 2024-04-03 06:36 | 115K | |
| SE SAQs - Unit 1.docx | 2023-11-07 23:37 | 19K | |
| SE Unit I.docx | 2023-11-07 23:37 | 3.4M | |
| SE_QP(April19).pdf | 2023-11-07 23:37 | 108K | |
| SE_Unit_I.PDF | 2023-11-07 23:37 | 1.8M | |
| SLR(1) table.jpg | 2023-11-07 23:38 | 52K | |
| SMA Syllabus.docx | 2023-11-07 23:38 | 884K | |
| SPMGMT-_BobH_Appendi..> | 2023-11-07 23:38 | 148K | |
| SPMGMT_10.ppt | 2023-11-07 23:38 | 1.0M | |
| SPMGMT_11.ppt | 2023-11-07 23:38 | 1.5M | |
| SPMGMT_12.ppt | 2023-11-07 23:38 | 1.2M | |
| SPMGMT_13.ppt | 2023-11-07 23:38 | 2.2M | |
| SPMGMT_14.ppt | 2023-11-07 23:38 | 1.9M | |
| SPMGMT_15.ppt | 2023-11-07 23:38 | 1.0M | |
| SPMGMT_16.ppt | 2023-11-07 23:38 | 330K | |
| SPMGMT_17.ppt | 2023-11-07 23:38 | 266K | |
| SPP.pdf | 2023-11-07 23:38 | 2.0M | |
| SQL.pdf | 2023-11-07 23:38 | 795K | |
| SSI.pptx | 2023-11-07 23:38 | 168K | |
| SSP Lab Manual.pdf | 2023-11-07 23:38 | 1.7M | |
| STUDENT FEEDBACK FOR..> | 2023-11-07 23:38 | 123K | |
| SUPPLY CHAIN ASSIGNM..> | 2023-11-07 23:38 | 347K | |
| SUPPLY CHAIN NOTES.pdf | 2023-11-07 23:39 | 13M | |
| Sample Emails.pdf | 2023-11-07 23:37 | 860K | |
| Sample Tutorial of W..> | 2023-11-07 23:37 | 1.2M | |
| Sample_Form.jpg | 2023-11-07 23:37 | 51K | |
| Schedule for Inducti..> | 2023-11-07 23:37 | 173K | |
| Search for Business ..> | 2023-11-07 23:37 | 424K | |
| Self Bias Bistable M..> | 2023-11-07 23:38 | 109M | |
| Sequencing Problem.pdf | 2023-11-07 23:37 | 2.2M | |
| Short Q & A.doc | 2023-11-07 23:37 | 132K | |
| Slides of Isometric ..> | 2023-11-07 23:38 | 2.1M | |
| Social Issues and En..> | 2023-11-07 23:38 | 7.5M | |
| Software Project Man..> | 2023-11-07 23:39 | 20M | |
| Software_Testing_Str..> | 2023-11-07 23:38 | 1.8M | |
| Solid Ground Curing ..> | 2023-11-07 23:38 | 1.0M | |
| Solid Mechanics_Unit..> | 2023-11-07 23:38 | 3.0M | |
| SpreadSpectrum.pdf | 2023-11-07 23:38 | 292K | |
| Spread_spectrum.pdf | 2023-11-07 23:38 | 3.7M | |
| StarUML-Overview.docx | 2023-11-07 23:38 | 21K | |
| Student Attended Sem..> | 2023-11-07 23:38 | 58K | |
| Stuffing Box assembl..> | 2023-11-07 23:38 | 9.1M | |
| Suffix prefix and ro..> | 2023-11-07 23:38 | 49K | |
| Syllabus.docx | 2023-11-07 23:39 | 17K | |
| Syllabus UEE.docx | 2023-11-07 23:39 | 12K | |
| System Engineering.doc | 2023-11-07 23:39 | 64K | |
| TE&ID U1 HWN.pdf | 2023-11-07 23:39 | 7.5M | |
| TE-II Lab Manual.pdf | 2023-11-07 23:39 | 2.8M | |
| TE - I Lab Manual.pdf | 2023-11-07 23:39 | 2.3M | |
| TEII-Rails HWN.pdf | 2023-11-07 23:39 | 3.6M | |
| TE lab.pdf | 2023-11-07 23:39 | 2.9M | |
| TKM -UNIT II.docx | 2023-11-07 23:39 | 125K | |
| TKM unit III.docx | 2023-11-07 23:39 | 960K | |
| TMS320C54X Presentat..> | 2023-11-07 23:39 | 1.2M | |
| TOS I.pdf | 2023-11-07 23:39 | 2.9M | |
| TQM syllabus_1.pdf | 2023-11-07 23:39 | 408K | |
| TT ECE 2022-2023.pdf | 2023-11-07 23:39 | 2.1M | |
| TTM LECTURE NOTES.pdf | 2023-11-07 23:40 | 13M | |
| Talent and Knowledge..> | 2023-11-07 23:39 | 172K | |
| Technical Communicat..> | 2023-11-07 23:39 | 3.5M | |
| Technical communicat..> | 2023-11-07 23:39 | 35K | |
| The Road not Taken.docx | 2023-11-07 23:39 | 27K | |
| Thermal engg lab man..> | 2023-11-07 23:39 | 1.8M | |
| Thiru_DBMS_Viva-FAQs..> | 2023-11-07 23:39 | 319K | |
| Timber.pdf | 2023-11-07 23:39 | 1.2M | |
| TimeDomainAnalysis.pptx | 2023-11-07 23:39 | 2.0M | |
| Time Table II YR III..> | 2023-11-07 23:39 | 20K | |
| Timetable EEE IV VI ..> | 2023-11-07 23:39 | 492K | |
| Time table III Sem 2..> | 2023-11-07 23:39 | 100K | |
| Time table I yr I se..> | 2023-11-07 23:39 | 24K | |
| Time table VII Sem 2..> | 2023-11-07 23:39 | 101K | |
| Time table V Sem 202..> | 2023-11-07 23:39 | 107K | |
| Transistor Monostabl..> | 2023-11-07 23:39 | 26M | |
| Transistor Schmitt T..> | 2023-11-07 23:40 | 48M | |
| Types of Letters.pdf | 2023-11-07 23:40 | 4.3M | |
| U2.pdf | 2023-11-07 23:40 | 1.9M | |
| U3- DNA the Central ..> | 2023-11-07 23:40 | 644K | |
| U3- Genetics -Medels..> | 2023-11-07 23:40 | 1.0M | |
| U3-Nucleic Acid as G..> | 2023-11-07 23:40 | 1.0M | |
| U3.pdf | 2023-11-07 23:40 | 1.1M | |
| U5.pdf | 2023-11-07 23:40 | 1.1M | |
| UML Concepts.pdf | 2023-11-07 23:40 | 1.8M | |
| UNIT -1.pdf | 2023-11-07 23:40 | 9.5M | |
| UNIT-1.pdf | 2023-11-07 23:43 | 20M | |
| UNIT-1 FACTS.pptx | 2023-11-07 23:43 | 2.8M | |
| UNIT-2.docx | 2023-11-07 23:44 | 211K | |
| UNIT-2 Sensors.pptx | 2023-11-07 23:44 | 68M | |
| UNIT-3.pdf | 2023-11-07 23:44 | 15M | |
| UNIT-3.pptx | 2023-11-07 23:44 | 1.2M | |
| UNIT-3 FACTS.pptx | 2023-11-07 23:44 | 1.9M | |
| UNIT-3 Illumination.ppt | 2023-11-07 23:44 | 6.5M | |
| UNIT-4.docx | 2023-11-07 23:44 | 28K | |
| UNIT-4.pptx | 2023-11-07 23:44 | 2.5M | |
| UNIT-II- SE.docx | 2023-11-07 23:44 | 841K | |
| UNIT-II-_SE.PDF | 2023-11-07 23:44 | 2.9M | |
| UNIT-III.pdf | 2023-11-07 23:44 | 970K | |
| UNIT-IV.pptx | 2023-11-07 23:45 | 6.6M | |
| UNIT-V.doc | 2023-11-07 23:45 | 1.1M | |
| UNIT-V.pptx | 2023-11-07 23:45 | 2.1M | |
| UNIT 1 & 2.pdf | 2023-11-07 23:40 | 14M | |
| UNIT1 ASS1 Q and ANS..> | 2023-11-07 23:45 | 21M | |
| UNIT 1 Electric Heat..> | 2023-11-07 23:40 | 4.0M | |
| UNIT 1RECTIFIERS.pdf | 2023-11-07 23:41 | 23M | |
| UNIT 1 STRESSES AND ..> | 2023-11-07 23:40 | 17M | |
| UNIT 1 TO 3 TEXT BOO..> | 2023-11-07 23:41 | 6.6M | |
| UNIT2 FACTS.pptx | 2023-11-07 23:45 | 2.3M | |
| UNIT 2 MANIFACTURING..> | 2023-11-07 23:41 | 12M | |
| UNIT 2 SHEAR FORCE A..> | 2023-11-07 23:42 | 19M | |
| UNIT 3.pdf | 2023-11-07 23:42 | 5.3M | |
| UNIT 3 English.docx | 2023-11-07 23:41 | 78K | |
| UNIT 3 THEORY OF SIM..> | 2023-11-07 23:42 | 12M | |
| UNIT 4.pdf | 2023-11-07 23:42 | 5.7M | |
| UNIT 4 DEFLECTION OF..> | 2023-11-07 23:42 | 7.2M | |
| UNIT4 FACTS.pptx | 2023-11-07 23:45 | 1.0M | |
| UNIT 4 MANUALS.docx | 2023-11-07 23:42 | 26K | |
| UNIT 4 SCR.pdf | 2023-11-07 23:42 | 6.0M | |
| UNIT 5 FACTS.pptx | 2023-11-07 23:42 | 182K | |
| UNIT 5 TORSION OF SH..> | 2023-11-07 23:43 | 16M | |
| UNIT I.pdf | 2023-11-07 23:43 | 253K | |
| UNIT II.PDF | 2023-11-07 23:43 | 9.7M | |
| UNIT III.pdf | 2023-11-07 23:43 | 1.0M | |
| UNIT IV.pdf | 2023-11-07 23:43 | 2.6M | |
| UNIT IV part-Hydrofo..> | 2023-11-07 23:43 | 1.0M | |
| UNIT V.pdf | 2023-11-07 23:43 | 5.1M | |
| UNIT_1_INFRASTRUCTUR..> | 2023-11-07 23:45 | 2.4M | |
| UNIT_1_INTRODUCTION ..> | 2023-11-07 23:45 | 165K | |
| UNIT_1_MINERALOGY123..> | 2023-11-07 23:45 | 330K | |
| UNIT_1_STRUCTURAL_GE..> | 2023-11-07 23:45 | 6.5M | |
| UNIT_3_INFRASTRUCTUR..> | 2023-11-07 23:45 | 324K | |
| UNIT_4_INFRASTRUCTUR..> | 2023-11-07 23:45 | 4.2M | |
| UNIT_5 PPT.pptx | 2023-11-07 23:45 | 1.6M | |
| UNIT_5_INFRASTRUCTUR..> | 2023-11-07 23:45 | 206K | |
| UNIT_5_TUNNELS.docx | 2023-11-07 23:45 | 200K | |
| Understanding-Facts-..> | 2023-11-07 23:41 | 56M | |
| Unit-1-1.ppt | 2023-11-07 23:43 | 658K | |
| Unit-1-2.ppt | 2023-11-07 23:43 | 1.8M | |
| Unit-1.docx | 2023-11-07 23:43 | 210K | |
| Unit-1.pptx | 2023-11-07 23:43 | 485K | |
| Unit-2-1.ppt | 2023-11-07 23:44 | 927K | |
| Unit-2-2.ppt | 2023-11-07 23:44 | 756K | |
| Unit-2.pdf | 2023-11-07 23:44 | 5.1M | |
| Unit-2 Part-A.docx | 2023-11-07 23:43 | 659K | |
| Unit-2 Part-B (1).docx | 2023-11-07 23:43 | 315K | |
| Unit -2 Text book m..> | 2023-11-07 23:40 | 4.8M | |
| Unit-3 (1).docx | 2023-11-07 23:44 | 857K | |
| Unit-3.docx | 2023-11-07 23:44 | 34K | |
| Unit-I-R&N-Renewable..> | 2023-11-07 23:44 | 1.2M | |
| Unit-I.pdf | 2023-11-07 23:44 | 167K | |
| Unit-IA.pdf | 2023-11-07 23:44 | 326K | |
| Unit-II-Ecosystem.ppt | 2023-11-07 23:44 | 15M | |
| Unit-II.pdf | 2023-11-07 23:44 | 1.2M | |
| Unit-III- Biodiversi..> | 2023-11-07 23:44 | 9.1M | |
| Unit-IV-Environmenta..> | 2023-11-07 23:45 | 5.4M | |
| Unit-IV.pdf | 2023-11-07 23:45 | 361K | |
| Unit-IV Disasters &D..> | 2023-11-07 23:45 | 1.2M | |
| Unit-V.pdf | 2023-11-07 23:45 | 182K | |
| Unit-VA.pdf | 2023-11-07 23:45 | 144K | |
| Unit 1Biomolecules.docx | 2023-11-07 23:41 | 2.1M | |
| Unit1_Exercises.pdf | 2023-11-07 23:45 | 600K | |
| Unit 1 metal casting..> | 2023-11-07 23:40 | 3.9M | |
| Unit 2 Basic Compute..> | 2023-11-07 23:41 | 9.4M | |
| Unit2 Photo voltaics..> | 2023-11-07 23:45 | 209K | |
| Unit 3 & 4 Chapter ..> | 2023-11-07 23:41 | 965K | |
| Unit 3 & 4 Chapter 2..> | 2023-11-07 23:41 | 2.2M | |
| Unit 3 & 4 Chapter 3..> | 2023-11-07 23:41 | 1.2M | |
| Unit 3 & 4 Chapter 4..> | 2023-11-07 23:41 | 823K | |
| Unit 3 & 4 Chapter 5..> | 2023-11-07 23:41 | 972K | |
| Unit 3 & 4 Chapter 6..> | 2023-11-07 23:41 | 1.3M | |
| Unit 3 & 4 Chapter 7..> | 2023-11-07 23:41 | 697K | |
| Unit 3 & 4 Chapter 8..> | 2023-11-07 23:41 | 172K | |
| Unit 3 & 4 Chapter 9..> | 2023-11-07 23:41 | 181K | |
| Unit 3 & 4 Chapter W..> | 2023-11-07 23:41 | 172K | |
| Unit 3 Report writin..> | 2023-11-07 23:42 | 29K | |
| Unit 4- EDM, TS & GP..> | 2023-11-07 23:42 | 1.9M | |
| Unit 4 English.docx | 2023-11-07 23:42 | 60K | |
| Unit 5 - Remote sens..> | 2023-11-07 23:43 | 18M | |
| Unit 5 English.docx | 2023-11-07 23:42 | 145K | |
| Unit 5 Information T..> | 2023-11-07 23:42 | 277K | |
| Unit 5 Manf. Process..> | 2023-11-07 23:42 | 1.3M | |
| Unit II-programming ..> | 2023-11-07 23:43 | 271K | |
| Unit IV part-HERF.pptx | 2023-11-07 23:43 | 3.2M | |
| UnitI_Strain energy ..> | 2023-11-07 23:45 | 1.8M | |
| Unit_3_1_AdvancedSQL..> | 2023-11-07 23:45 | 556K | |
| Unit_3_2_Normalizati..> | 2023-11-07 23:45 | 551K | |
| Unit_4_1_Indexing_Ha..> | 2023-11-07 23:45 | 1.6M | |
| Unit_4_2_Transaction..> | 2023-11-07 23:45 | 1.2M | |
| Unit_5 TMS320C54X.pptx | 2023-11-07 23:45 | 1.1M | |
| Unit_5_1_Concurrency..> | 2023-11-07 23:45 | 1.2M | |
| Unit_5_2_RecoverySys..> | 2023-11-07 23:45 | 484K | |
| Unit_III_-_SE.PDF | 2023-11-07 23:45 | 1.9M | |
| Unit_IV.PDF | 2023-11-07 23:45 | 1.7M | |
| Unitwise questions.docx | 2023-11-07 23:45 | 91K | |
| V & VI SEM syllabus ..> | 2023-11-07 23:45 | 935K | |
| VI-SEM 2020-21 TIMET..> | 2023-11-07 23:45 | 1.7M | |
| VI-SEM TIMETABLE MEC..> | 2024-04-03 05:30 | 708K | |
| VI A AND B SEMESTER.pdf | 2024-04-03 06:14 | 277K | |
| VIDEOLECTURES-Dr.JRK..> | 2023-11-07 23:45 | 1.3M | |
| VIDEO LECT_S-M_I .docx | 2023-11-07 23:45 | 12K | |
| VII & VIII BE (CSE) ..> | 2023-11-07 23:45 | 14M | |
| VIII-SEM TIMETABLE M..> | 2024-04-03 05:30 | 564K | |
| V UNIT NOTES.docx | 2023-11-07 23:45 | 116K | |
| Video Lessons for 2n..> | 2023-11-07 23:45 | 11K | |
| Video lessons for 4t..> | 2023-11-07 23:45 | 10K | |
| Vocabulary.pdf | 2023-11-07 23:46 | 4.0M | |
| Voice and Narrated S..> | 2023-11-07 23:46 | 15K | |
| WEB PROGRAMMING.pdf | 2023-11-07 23:46 | 9.5M | |
| WRE 1.pdf | 2023-11-07 23:46 | 26M | |
| WRE 1 Unit-V.pdf | 2023-11-07 23:46 | 2.1M | |
| WS Lab Manual.pdf | 2023-11-07 23:47 | 11M | |
| Water Chemistry & Co..> | 2023-11-07 23:46 | 838K | |
| Water Chemistry & Co..> | 2023-11-07 23:46 | 838K | |
| Week 1- Introduction..> | 2023-11-07 23:46 | 1.4M | |
| Week 3 - Wastewater ..> | 2023-11-07 23:46 | 950K | |
| WhatsApp Image 2021-..> | 2023-11-07 23:46 | 100K | |
| WhatsApp Image 2021-..> | 2023-11-07 23:46 | 100K | |
| WhatsApp Image 2021-..> | 2023-11-07 23:46 | 101K | |
| WhatsApp Image 2021-..> | 2023-11-07 23:46 | 107K | |
| Work Sheet I.docx | 2023-11-07 23:46 | 17K | |
| Workshops_ Seminars_..> | 2023-11-07 23:46 | 3.7M | |
| XHTML.pdf | 2023-11-07 23:47 | 1.9M | |
| _unit 5.pdf | 2023-11-07 23:47 | 22M | |
| aaa.php | 2024-01-23 17:58 | 78K | |
| addressing modes.pptx | 2023-11-07 23:15 | 222K | |
| ak47shell.php | 2023-11-07 23:15 | 3.3K | |
| almanac of B.E I and..> | 2023-11-07 23:15 | 676K | |
| almanac of M.E I and..> | 2023-11-07 23:15 | 682K | |
| animal-organ-systems..> | 2023-11-07 23:15 | 12M | |
| apps.php | 2024-01-15 12:09 | 7.0K | |
| arbiter.docx | 2023-11-07 23:15 | 93K | |
| assessment.pdf | 2023-11-07 23:15 | 154K | |
| assignment.docx | 2023-11-07 23:15 | 13K | |
| asy2.pdf | 2023-11-07 23:16 | 816K | |
| awp lecture by drdo ..> | 2023-11-07 23:17 | 46M | |
| awp notes.pdf | 2023-11-07 23:16 | 5.3M | |
| b374k.php | 2023-11-07 23:16 | 0 | |
| business proposals (..> | 2023-11-07 23:17 | 8.5M | |
| business proposals.pdf | 2023-11-07 23:17 | 8.5M | |
| castingdefects-17111..> | 2023-11-07 23:17 | 846K | |
| ch-01.ppt | 2023-11-07 23:17 | 3.3M | |
| ch-02.ppt | 2023-11-07 23:17 | 3.3M | |
| ch-03.ppt | 2023-11-07 23:17 | 1.8M | |
| ch-04.ppt | 2023-11-07 23:17 | 1.8M | |
| ch-06.ppt | 2023-11-07 23:17 | 2.2M | |
| ch4-1.pdf | 2023-11-07 23:17 | 282K | |
| ch 5 viewing.ppt | 2023-11-07 23:17 | 2.4M | |
| ch7.pptx | 2023-11-07 23:17 | 1.8M | |
| ch7_Trees (1).ppt | 2023-11-07 23:17 | 289K | |
| chapter 1 (1).pdf | 2023-11-07 23:17 | 4.0M | |
| chapter 1.pdf | 2023-11-07 23:17 | 477K | |
| chapter 2 sen 1.pdf | 2023-11-07 23:17 | 4.2M | |
| chapter 3 sem 1.pdf | 2023-11-07 23:17 | 2.3M | |
| chapter4MCI.pdf | 2023-11-07 23:17 | 457K | |
| chapter 4 sem 1.pdf | 2023-11-07 23:17 | 1.0M | |
| chapter5a (1).pdf | 2023-11-07 23:17 | 515K | |
| chapter 5 sem 1.pdf | 2023-11-07 23:17 | 5.8M | |
| chp3.pdf | 2023-11-07 23:17 | 399K | |
| circular water tank-..> | 2023-11-07 23:18 | 3.6M | |
| class -TT -Even Sem-..> | 2024-02-26 15:48 | 180K | |
| class -TT -Even Sem-..> | 2024-02-26 15:50 | 246K | |
| class -TT -Odd Sem-A..> | 2024-02-26 15:49 | 236K | |
| class -TT -Odd Sem-A..> | 2024-02-26 15:50 | 187K | |
| class-method.ppt | 2023-11-07 23:18 | 313K | |
| classes-objects.ppt | 2023-11-07 23:18 | 210K | |
| closed loop control ..> | 2023-11-07 23:18 | 67K | |
| cn notes(10).pdf | 2023-11-07 23:19 | 36M | |
| co lab cycle-2.pdf | 2023-11-07 23:18 | 663K | |
| controllers and comp..> | 2023-11-07 23:18 | 688K | |
| cooling systems.pptx | 2023-11-07 23:18 | 1.5M | |
| counters_and_registe..> | 2023-11-07 23:18 | 2.1M | |
| covering letter for ..> | 2023-11-07 23:18 | 221K | |
| data_types,_declarat..> | 2023-11-07 23:19 | 357K | |
| day wise schedule.pdf | 2023-11-07 23:19 | 370K | |
| dbms lab record MAI..> | 2023-11-07 23:19 | 133K | |
| dc-unit1 short qus a..> | 2023-11-07 23:19 | 31K | |
| dc and ac drives.docx | 2023-11-07 23:19 | 28K | |
| dccn cbcs.pdf | 2023-11-07 23:19 | 235K | |
| dc generator charact..> | 2023-11-07 23:19 | 2.7M | |
| dc unit 2 short que ..> | 2023-11-07 23:19 | 31K | |
| device drivers.docx | 2023-11-07 23:20 | 111K | |
| disaster-management...> | 2023-11-07 23:20 | 2.8M | |
| dma-controller-82571..> | 2023-11-07 23:20 | 707K | |
| dom unit 4 and 5.pdf | 2023-11-07 23:20 | 11M | |
| dsp _OU_qp.pdf | 2023-11-07 23:21 | 1.4M | |
| dual converter fed d..> | 2023-11-07 23:21 | 584K | |
| edited_VLSI DESIGN U..> | 2023-11-07 23:21 | 1.2M | |
| edited_VLSI DESIGN U..> | 2023-11-07 23:21 | 1.9M | |
| edited_VLSI DESIGN U..> | 2023-11-07 23:21 | 1.2M | |
| edited_edited_VLSI D..> | 2023-11-07 23:21 | 3.7M | |
| edited_edited_VLSI D..> | 2023-11-07 23:21 | 1.8M | |
| energy sources.pdf | 2023-11-07 23:22 | 1.2M | |
| engine components.pptx | 2023-11-07 23:22 | 8.2M | |
| engineering-curves.ppt | 2023-11-07 23:22 | 1.9M | |
| est unit 1.pdf | 2023-11-07 23:23 | 18M | |
| facts__unit-5_and_6...> | 2023-11-07 23:23 | 2.1M | |
| fet ppt.pptx | 2023-11-07 23:23 | 265K | |
| greenchemistry.pptx | 2023-11-07 23:24 | 2.0M | |
| greenchemistry ppt.pptx | 2023-11-07 23:24 | 2.0M | |
| iafm unit-2.pptx | 2023-11-07 23:25 | 1.0M | |
| iafm unit3.ppt | 2023-11-07 23:25 | 1.3M | |
| iafm unit 5.pptx | 2023-11-07 23:25 | 61K | |
| ideal diffrentiator.pdf | 2023-11-07 23:25 | 836K | |
| ideal integrator.pdf | 2023-11-07 23:25 | 929K | |
| ideal inv n.inv.pdf | 2023-11-07 23:25 | 1.0M | |
| ignition system.pptx | 2023-11-07 23:25 | 1.4M | |
| image_2021-01-12_071..> | 2023-11-07 23:25 | 221K | |
| immunization.ppt | 2023-11-07 23:25 | 355K | |
| introduction & class..> | 2023-11-07 23:26 | 6.4M | |
| introduction-to-data..> | 2023-11-07 23:26 | 299K | |
| java-notes.pdf | 2023-11-07 23:26 | 9.0M | |
| java.pdf | 2023-11-07 23:27 | 12M | |
| knuckle joint assemb..> | 2023-11-07 23:27 | 4.3M | |
| lec32 - Construction..> | 2023-11-07 23:29 | 49M | |
| lecture1.pdf | 2023-11-07 23:29 | 763K | |
| lecture2 probality d..> | 2023-11-07 23:29 | 240K | |
| lecture3 linear regr..> | 2023-11-07 23:29 | 118K | |
| lecture3 methods of ..> | 2023-11-07 23:29 | 156K | |
| lecture4 multiple li..> | 2023-11-07 23:29 | 128K | |
| lecture4 para meter ..> | 2023-11-07 23:29 | 151K | |
| lecture5 hypothesis ..> | 2023-11-07 23:29 | 196K | |
| lecture5 oter topics..> | 2023-11-07 23:29 | 75K | |
| lecture_32_algorithm..> | 2023-11-07 23:30 | 84M | |
| lecture notes on wel..> | 2023-11-07 23:29 | 239K | |
| lica imp qustns 2 ma..> | 2023-11-07 23:29 | 1.2M | |
| link 1.docx | 2023-11-07 23:29 | 9.9K | |
| lnotes.pdf | 2023-11-07 23:29 | 2.8M | |
| loadequalisation.docx | 2023-11-07 23:29 | 81K | |
| log amp.pdf | 2023-11-07 23:29 | 2.4M | |
| lubrication system.pptx | 2023-11-07 23:29 | 1.9M | |
| m3 unit 2.pdf | 2023-11-07 23:30 | 15M | |
| m3 unit 5.pdf | 2023-11-07 23:30 | 5.7M | |
| machine design UNIT1..> | 2023-11-07 23:30 | 14M | |
| machine design unit4..> | 2023-11-07 23:30 | 1.5M | |
| mcet_broucher-2023.pdf | 2023-11-07 23:30 | 31M | |
| mcet_broucher.pdf | 2023-11-07 23:30 | 2.1M | |
| mech_placement_2019.pdf | 2023-11-07 23:30 | 92K | |
| mech_placement_2020.pdf | 2023-11-07 23:30 | 88K | |
| memory.ppt | 2023-11-07 23:30 | 3.0M | |
| metrology and instru..> | 2023-11-07 23:31 | 11M | |
| metrology and instru..> | 2023-11-07 23:31 | 10M | |
| metrology and instru..> | 2023-11-07 23:31 | 9.2M | |
| mini2022.php | 2024-01-23 17:59 | 8.2K | |
| misc psc.pdf | 2023-11-07 23:31 | 4.7M | |
| mono stable aa-stabl..> | 2023-11-07 23:32 | 1.1M | |
| monostable miltivibr..> | 2023-11-07 23:32 | 8.0M | |
| monostable multivibr..> | 2023-11-07 23:32 | 5.8M | |
| mpmc pin desc.pptx | 2023-11-07 23:32 | 114K | |
| mwe unit 4 SRAVAN NO..> | 2023-11-07 23:32 | 4.5M | |
| mwe unit 5 SRAVAN NO..> | 2023-11-07 23:32 | 12M | |
| nces unit1.ppt | 2023-11-07 23:33 | 2.0M | |
| nces unit3.pptx | 2023-11-07 23:33 | 2.4M | |
| nces unit4.ppt | 2023-11-07 23:33 | 4.2M | |
| nces unit5.pptx | 2023-11-07 23:33 | 33K | |
| nce unit2.pptx | 2023-11-07 23:33 | 2.3M | |
| p2018/ | 2023-11-08 07:46 | - | |
| p2019/ | 2023-11-08 07:46 | - | |
| pdic.pdf | 2023-11-07 23:34 | 22M | |
| pdic2.pdf | 2023-11-07 23:34 | 16M | |
| pdic unit1,2,3 vsaqs..> | 2023-11-07 23:34 | 28K | |
| pdic unit 4 short qu..> | 2023-11-07 23:34 | 19K | |
| pdic unit 5 short qu..> | 2023-11-07 23:34 | 16K | |
| placement.png | 2023-11-07 23:35 | 65K | |
| placement_List_CIVIL..> | 2023-11-07 23:35 | 7.4M | |
| placement_List_CIVIL..> | 2023-11-07 23:35 | 15K | |
| placement_List_CSE.pdf | 2023-11-07 23:35 | 7.6M | |
| placement_info_cse1.PNG | 2023-11-07 23:35 | 26K | |
| placement_info_cse2.PNG | 2023-11-07 23:35 | 11K | |
| plate girder with IT..> | 2023-11-07 23:35 | 745K | |
| practical diffrentia..> | 2023-11-07 23:35 | 621K | |
| practical integrator..> | 2023-11-07 23:35 | 463K | |
| prerequisites of HMS..> | 2023-11-07 23:35 | 148K | |
| programmable logic d..> | 2023-11-07 23:35 | 422K | |
| projectionsofsolid.pdf | 2023-11-07 23:36 | 1.1M | |
| record FP.pdf | 2023-11-07 23:36 | 452K | |
| result url.docx | 2023-11-07 23:36 | 9.9K | |
| res unit-1.ppt | 2023-11-07 23:36 | 3.7M | |
| rocker and roller be..> | 2023-11-07 23:36 | 1.9M | |
| scales.ppt | 2023-11-07 23:37 | 1.8M | |
| sections of solids.pdf | 2023-11-07 23:37 | 1.0M | |
| sedd 2 unit 3.pdf | 2023-11-07 23:37 | 768K | |
| seminar MBA.pdf | 2023-11-07 23:37 | 1.2M | |
| simple-eccentric 3D.mp4 | 2023-11-07 23:38 | 4.7M | |
| sml_ | 2023-11-17 13:06 | 1.1K | |
| sml_01 BE (CSE)2020-..> | 2023-11-07 23:38 | 1.1K | |
| sml_1. BE AMC Civil ..> | 2023-11-07 23:38 | 1.1K | |
| sml_1. CBCS 78 Civil..> | 2023-11-07 23:38 | 1.1K | |
| sml_9.class timetabl..> | 2023-11-07 23:38 | 5.7K | |
| sml_9.class timetabl..> | 2023-11-07 23:38 | 4.8K | |
| sml_9.class timetabl..> | 2023-11-07 23:38 | 4.9K | |
| sml_9.class timetabl..> | 2023-11-07 23:38 | 6.2K | |
| sml_9.class timetabl..> | 2023-11-07 23:38 | 5.1K | |
| sml_9.class timetabl..> | 2023-11-07 23:38 | 4.9K | |
| sml_22-23 ODD-SEM ME..> | 2023-11-07 23:38 | 1.1K | |
| sml_2020-21_III Sem_..> | 2023-11-07 23:38 | 1.1K | |
| sml_2020-21_VII Sem_..> | 2023-11-07 23:38 | 1.1K | |
| sml_2020-21_V Sem_TT..> | 2023-11-07 23:38 | 1.1K | |
| sml_2023-24 EVEN SEM..> | 2024-02-26 16:03 | 1.1K | |
| sml_2023-24 ODD SEM.PDF | 2024-02-26 16:02 | 1.1K | |
| sml_ACADEMIC CLAENDA..> | 2023-11-07 23:38 | 1.1K | |
| sml_AICTE 7 and 8 se..> | 2024-02-26 15:59 | 1.1K | |
| sml_AICTE NEW SCHEME..> | 2023-11-07 23:38 | 1.1K | |
| sml_AICTE OLD SCHEME..> | 2023-11-07 23:38 | 1.1K | |
| sml_AI_DS IV A AND ..> | 2024-04-03 06:06 | 1.1K | |
| sml_AI_DS SEM-II A B..> | 2024-04-03 06:39 | 1.1K | |
| sml_AI_DS Sem-III 20..> | 2023-11-24 09:26 | 1.1K | |
| sml_AI_DS Sem-IV 202..> | 2023-11-24 09:26 | 1.1K | |
| sml_AI_DS Sem-V 2023..> | 2023-11-24 09:25 | 1.1K | |
| sml_AI_DS Sem-VI 202..> | 2023-11-24 09:25 | 1.1K | |
| sml_AI_DS Syllabus ..> | 2023-11-07 23:38 | 1.1K | |
| sml_AI_DS VI A AND ..> | 2024-04-03 06:06 | 1.1K | |
| sml_AI_DS VIII SEM ..> | 2024-04-03 06:07 | 1.1K | |
| sml_AI_ML SEM-II A ..> | 2024-04-03 06:38 | 1.1K | |
| sml_AMC I _ II SEM S..> | 2023-11-07 23:38 | 1.1K | |
| sml_AMC V _ VI SEM S..> | 2023-11-07 23:38 | 1.1K | |
| sml_Academic Calenda..> | 2023-11-07 23:38 | 1.1K | |
| sml_Almanac MBA Sem-..> | 2023-11-07 23:38 | 1.1K | |
| sml_Almanac MBA Sem-..> | 2023-11-07 23:38 | 1.1K | |
| sml_Almanac MBA Sem-..> | 2023-11-07 23:38 | 1.1K | |
| sml_Almanac for 2018..> | 2023-11-07 23:38 | 4.2K | |
| sml_B.E-III-Sem Alma..> | 2024-02-26 15:53 | 1.1K | |
| sml_B.E.II Sem (Auto..> | 2023-11-07 23:38 | 3.9K | |
| sml_B.E III Sem.jpg | 2023-11-17 12:42 | 3.5K | |
| sml_B.E I Sem.jpg | 2023-11-17 12:42 | 3.6K | |
| sml_B.E MECH-AUTONOM..> | 2023-11-07 23:38 | 1.1K | |
| sml_B.E V Sem.jpg | 2023-11-17 12:43 | 3.5K | |
| sml_BE-12-RULES_AND_..> | 2023-11-07 23:38 | 1.1K | |
| sml_BE-12-sem-syllab..> | 2023-11-07 23:38 | 1.1K | |
| sml_BE-34-sem-syllab..> | 2023-11-07 23:38 | 1.1K | |
| sml_BE-78-sem-syllab..> | 2023-11-07 23:38 | 1.1K | |
| sml_CBCS-Civil-V_VI_..> | 2023-11-07 23:38 | 1.1K | |
| sml_CBCS VII _ VIII ..> | 2023-11-07 23:38 | 1.1K | |
| sml_CIVIL IVSEM-TT.pdf | 2024-04-03 06:27 | 1.1K | |
| sml_CIVIL VI-sem TT.pdf | 2024-04-03 06:28 | 1.1K | |
| sml_CIVIL VIII-A-TT.pdf | 2024-04-03 22:48 | 1.1K | |
| sml_CSE IV SEM TIME ..> | 2024-04-03 06:07 | 1.1K | |
| sml_CSE Sem-III 2023..> | 2023-11-24 09:21 | 1.1K | |
| sml_CSE Sem-IV 2023-..> | 2023-11-24 09:21 | 1.1K | |
| sml_CSE Sem-V 2023-2..> | 2023-11-24 07:43 | 1.1K | |
| sml_CSE Sem-VI 2023-..> | 2023-11-24 07:43 | 1.1K | |
| sml_CSE VI A AND B ..> | 2024-04-03 06:08 | 1.1K | |
| sml_CSE VIII SEM TIM..> | 2024-04-03 06:08 | 1.1K | |
| sml_College ACADEMIC..> | 2023-11-07 23:38 | 1.1K | |
| sml_ECE Autonomous S..> | 2024-02-26 15:56 | 1.1K | |
| sml_ECE IV A AND B S..> | 2024-04-03 06:14 | 1.1K | |
| sml_ECE Sem-III 2023..> | 2023-11-24 09:33 | 1.1K | |
| sml_ECE Sem-IV 2023-..> | 2023-11-24 09:33 | 1.1K | |
| sml_ECE Sem-V 2023-2..> | 2023-11-24 09:32 | 1.1K | |
| sml_ECE Sem-VI 2023-..> | 2023-11-24 09:32 | 1.1K | |
| sml_ECE VIII A AND B..> | 2024-04-03 06:14 | 1.1K | |
| sml_EEE A.Y 2023-24,..> | 2024-04-03 06:20 | 1.1K | |
| sml_EEE AY 23-24 VI ..> | 2024-04-03 06:21 | 1.1K | |
| sml_EEE Sem-III 2023..> | 2023-11-24 09:31 | 1.1K | |
| sml_EEE Sem-IV 2023-..> | 2023-11-24 09:31 | 1.1K | |
| sml_EEE Sem-V 2023-2..> | 2023-11-24 09:31 | 1.1K | |
| sml_EEE Sem-VI 2023-..> | 2023-11-24 09:30 | 1.1K | |
| sml_EEE VIII SEM TT.pdf | 2024-04-03 06:29 | 1.1K | |
| sml_Even Sem Time Ta..> | 2023-11-07 23:38 | 1.1K | |
| sml_Even Sem almanac..> | 2023-11-07 23:38 | 1.1K | |
| sml_II, IV & VI Sem ..> | 2024-03-15 11:45 | 4.0K | |
| sml_III & IV SEM SYL..> | 2023-11-07 23:38 | 1.1K | |
| sml_IV-SEM 2020-21 T..> | 2023-11-07 23:38 | 1.1K | |
| sml_IV-SEM TIMETABLE..> | 2024-04-03 05:29 | 1.1K | |
| sml_M.E I Sem CAD CA..> | 2023-11-17 12:43 | 3.5K | |
| sml_MBA & ME almanac..> | 2023-11-07 23:38 | 4.0K | |
| sml_MBA I & II Sem ..> | 2023-11-07 23:38 | 1.1K | |
| sml_MBA I-III sem TT..> | 2023-11-07 23:38 | 1.1K | |
| sml_MBA II-IV sem Ti..> | 2023-11-07 23:38 | 1.1K | |
| sml_MBA III & IV SEM..> | 2023-11-07 23:38 | 1.1K | |
| sml_MBA II SEMESTER.pdf | 2024-04-03 22:52 | 1.1K | |
| sml_MBA I Sem.jpg | 2023-11-17 12:43 | 3.5K | |
| sml_MBA IV SEMESTER.pdf | 2024-04-03 22:59 | 1.1K | |
| sml_ME,MBA OU.jpg | 2023-11-07 23:38 | 4.2K | |
| sml_MECH Sem-III 202..> | 2023-11-24 09:35 | 1.1K | |
| sml_MECH Sem-IV 2023..> | 2023-11-24 09:35 | 1.1K | |
| sml_MECH Sem-V 2023-..> | 2023-11-24 09:35 | 1.1K | |
| sml_MECH Sem-VI 2023..> | 2023-11-24 09:34 | 1.1K | |
| sml_Odd sem Almanac ..> | 2023-11-07 23:38 | 1.1K | |
| sml_Odd sem TimeTabl..> | 2023-11-07 23:38 | 1.1K | |
| sml_Ou almanac.jpg | 2023-11-07 23:38 | 5.1K | |
| sml_Revised_M.E_Alma..> | 2023-11-07 23:38 | 1.1K | |
| sml_SEM-II CIVIL TI..> | 2024-04-03 06:35 | 1.1K | |
| sml_SEM-II CSE A B C..> | 2024-04-03 06:39 | 1.1K | |
| sml_SEM-II ECE TIME..> | 2024-04-03 06:38 | 1.1K | |
| sml_SEM-II EEE TIME..> | 2024-04-03 06:35 | 1.1K | |
| sml_SEM-II MECH TIM..> | 2024-04-03 06:36 | 1.1K | |
| sml_TT ECE 2022-202..> | 2023-11-07 23:38 | 1.1K | |
| sml_Time Table II YR..> | 2023-11-07 23:38 | 1.1K | |
| sml_Timetable EEE IV..> | 2023-11-07 23:38 | 1.1K | |
| sml_Time table III S..> | 2023-11-07 23:38 | 3.9K | |
| sml_Time table I yr ..> | 2023-11-07 23:38 | 1.1K | |
| sml_Time table VII S..> | 2023-11-07 23:38 | 4.0K | |
| sml_Time table V Sem..> | 2023-11-07 23:38 | 3.9K | |
| sml_V & VI SEM sylla..> | 2023-11-07 23:38 | 1.1K | |
| sml_VI-SEM 2020-21 T..> | 2023-11-07 23:38 | 1.1K | |
| sml_VI-SEM TIMETABLE..> | 2024-04-03 05:30 | 1.1K | |
| sml_VI A AND B SEMES..> | 2024-04-03 06:14 | 1.1K | |
| sml_VII & VIII BE (C..> | 2023-11-07 23:38 | 1.1K | |
| sml_VIII-SEM TIMETAB..> | 2024-04-03 05:30 | 1.1K | |
| sml_WhatsApp Image 2..> | 2023-11-07 23:38 | 3.9K | |
| sml_WhatsApp Image 2..> | 2023-11-07 23:38 | 3.9K | |
| sml_WhatsApp Image 2..> | 2023-11-07 23:38 | 4.0K | |
| sml_WhatsApp Image 2..> | 2023-11-07 23:38 | 3.9K | |
| sml_aaa.php | 2024-01-23 17:58 | 1.1K | |
| sml_ak47shell.php | 2023-11-07 23:38 | 1.1K | |
| sml_almanac of B.E I..> | 2023-11-07 23:38 | 1.1K | |
| sml_almanac of M.E I..> | 2023-11-07 23:38 | 1.1K | |
| sml_apps.php | 2024-01-15 12:09 | 1.1K | |
| sml_b374k.php | 2023-11-07 23:38 | 1.1K | |
| sml_class -TT -Even ..> | 2024-02-26 15:48 | 1.1K | |
| sml_class -TT -Even ..> | 2024-02-26 15:50 | 1.1K | |
| sml_class -TT -Odd S..> | 2024-02-26 15:49 | 1.1K | |
| sml_class -TT -Odd S..> | 2024-02-26 15:50 | 1.1K | |
| sml_mini2022.php | 2024-01-23 17:59 | 1.1K | |
| sml_timetable 20-21_..> | 2023-11-07 23:38 | 6.2K | |
| sml_timetable 20-21_..> | 2023-11-07 23:38 | 6.3K | |
| sml_timetable 20-21_..> | 2023-11-07 23:38 | 6.2K | |
| softwares used for E..> | 2023-11-07 23:38 | 1.4M | |
| solar power plant (1..> | 2023-11-07 23:38 | 3.2M | |
| speard spec.pdf | 2023-11-07 23:38 | 887K | |
| spm-june-2016-QP.pdf | 2023-11-07 23:38 | 28K | |
| spm-may-2016-questio..> | 2023-11-07 23:38 | 181K | |
| ss-1.jpg | 2023-11-07 23:38 | 1.4M | |
| ss-2.jpg | 2023-11-07 23:38 | 1.3M | |
| steering system.pptx | 2023-11-07 23:38 | 2.7M | |
| stereolithography pp..> | 2023-11-07 23:38 | 941K | |
| stretch forming.pptx | 2023-11-07 23:38 | 3.1M | |
| substractor.pdf | 2023-11-07 23:38 | 568K | |
| suspention system.pptx | 2023-11-07 23:39 | 2.7M | |
| svf.pdf | 2023-11-07 23:39 | 697K | |
| syallabus of mpmc.docx | 2023-11-07 23:39 | 11K | |
| tailstock of a lathe..> | 2023-11-07 23:39 | 11M | |
| testing of DC machin..> | 2023-11-07 23:39 | 158K | |
| the Sporting spirit...> | 2023-11-07 23:39 | 14K | |
| timetable 20-21_page..> | 2023-11-07 23:39 | 218K | |
| timetable 20-21_page..> | 2023-11-07 23:39 | 325K | |
| timetable 20-21_page..> | 2023-11-07 23:39 | 356K | |
| toc-klp-mishra.pdf | 2023-11-07 23:39 | 17M | |
| transmission system...> | 2023-11-07 23:39 | 3.2M | |
| tyres and wheels.pptx | 2023-11-07 23:40 | 3.1M | |
| u1.pdf | 2023-11-07 23:40 | 1.1M | |
| u4.pdf | 2023-11-07 23:40 | 1.3M | |
| unit-1.ppt | 2023-11-07 23:43 | 5.0M | |
| unit-2-2.pptx | 2023-11-07 23:44 | 4.6M | |
| unit-2-3.pptx | 2023-11-07 23:44 | 2.6M | |
| unit-2.pptx | 2023-11-07 23:44 | 240K | |
| unit-2 RCC.pdf | 2023-11-07 23:43 | 9.0M | |
| unit-2 dma.pptx | 2023-11-07 23:43 | 307K | |
| unit-2 quest.docx | 2023-11-07 23:43 | 12K | |
| unit-4.pdf | 2023-11-07 23:44 | 13M | |
| unit-4 waveform gene..> | 2023-11-07 23:44 | 8.0M | |
| unit-5.pdf | 2023-11-07 23:44 | 3.4M | |
| unit 1 (MTE).pdf | 2023-11-07 23:40 | 680K | |
| unit1.docx | 2023-11-07 23:45 | 411K | |
| unit 1.pdf | 2023-11-07 23:41 | 21M | |
| unit1.pdf | 2023-11-07 23:45 | 2.2M | |
| unit 1PSC.pdf | 2023-11-07 23:41 | 12M | |
| unit 1RCC.pdf | 2023-11-07 23:41 | 9.6M | |
| unit 1 entp.pdf | 2023-11-07 23:40 | 361K | |
| unit 1 notes_2020-02..> | 2023-11-07 23:40 | 1.2M | |
| unit 1 psc.pdf | 2023-11-07 23:40 | 4.5M | |
| unit 1 sdd1.pdf | 2023-11-07 23:40 | 17M | |
| unit 2.pdf | 2023-11-07 23:41 | 10M | |
| unit2.pdf | 2023-11-07 23:45 | 22M | |
| unit 2 3 psc.pdf | 2023-11-07 23:41 | 8.8M | |
| unit 2 PSC.pdf | 2023-11-07 23:41 | 5.0M | |
| unit 2 co.pptx | 2023-11-07 23:41 | 1.5M | |
| unit 2 entrepreneurs..> | 2023-11-07 23:41 | 211K | |
| unit 2 sdd1.pdf | 2023-11-07 23:41 | 29M | |
| unit3 (2).docx | 2023-11-07 23:45 | 19K | |
| unit 3 Proj formulat..> | 2023-11-07 23:41 | 355K | |
| unit 3 Q & A.docx | 2023-11-07 23:42 | 15K | |
| unit 3RCC.pdf | 2023-11-07 23:42 | 7.9M | |
| unit3_DM.ppt | 2023-11-07 23:45 | 2.3M | |
| unit3 eme hydraulics..> | 2023-11-07 23:45 | 3.1M | |
| unit 3 psc cont.pdf | 2023-11-07 23:42 | 4.1M | |
| unit 3 sdd1.pdf | 2023-11-07 23:42 | 9.8M | |
| unit4.pdf | 2023-11-07 23:45 | 2.0M | |
| unit 4 Project manag..> | 2023-11-07 23:42 | 359K | |
| unit4 Q &A.doc | 2023-11-07 23:45 | 122K | |
| unit 4 RCC.pdf | 2023-11-07 23:42 | 9.3M | |
| unit 4 and 5.pdf | 2023-11-07 23:42 | 8.4M | |
| unit 4 operational a..> | 2023-11-07 23:42 | 9.8M | |
| unit 4 psc.pdf | 2023-11-07 23:42 | 4.6M | |
| unit 5-psc.pdf | 2023-11-07 23:44 | 15M | |
| unit 5 .pdf | 2023-11-07 23:42 | 4.0M | |
| unit 5.pdf | 2023-11-07 23:43 | 723K | |
| unit5.pdf | 2023-11-07 23:45 | 3.2M | |
| unit 5 Behavioural a..> | 2023-11-07 23:42 | 170K | |
| unit 5 Q&A.docx | 2023-11-07 23:43 | 19K | |
| unit 5 RCC.pdf | 2023-11-07 23:43 | 9.8M | |
| unit 5digital system..> | 2023-11-07 23:43 | 8.1M | |
| unit 5 psc.pdf | 2023-11-07 23:43 | 9.5M | |
| unit ques bank.docx | 2023-11-07 23:43 | 15K | |
| unit wise short Qs.docx | 2023-11-07 23:43 | 333K | |
| universal coupling[1..> | 2023-11-07 23:45 | 9.1M | |
| vco.pdf | 2023-11-07 23:45 | 743K | |
| vhdl.docx | 2023-11-07 23:45 | 105K | |
| videoplayback (1).mp4 | 2023-11-07 23:47 | 124M | |
| viva questions-cg.docx | 2023-11-07 23:45 | 59K | |
| vlsi assignment2.docx | 2023-11-07 23:45 | 12K | |
| vlsi notes.pdf | 2023-11-07 23:46 | 13M | |
| v to i converter.pdf | 2023-11-07 23:45 | 408K | |
| water hammer forming..> | 2023-11-07 23:46 | 471K | |
| waveforms of balance..> | 2023-11-07 23:46 | 1.0M | |
| weathering.pptx | 2023-11-07 23:46 | 25M | |
| windturbine-lift and..> | 2023-11-07 23:46 | 1.3M | |
| wlanpan.pptx | 2023-11-07 23:46 | 803K | |
| wp lab manual (2).docx | 2023-11-07 23:46 | 468K | |
| wsceee.pdf | 2023-11-07 23:47 | 703K | |
| wst.php | 2023-11-07 23:47 | 0 | |
| y2mate.com - digital..> | 2023-11-07 23:47 | 83M | |
|
|---|
_page-0001.jpg){kind=link}
_page-0002.jpg){kind=link}
_page-0003.jpg){kind=link}
.JPG){kind=link}
%20Almanac.jpg){kind=link}
.jpg){kind=link}
.jpg){kind=link}
%20table.jpg){kind=link}
%20(1).jpeg){kind=link}
.jpeg){kind=link}
%20Almanac.jpg){kind=link}
%20(1).jpeg){kind=link}
.jpeg){kind=link}
